Select a section from the left sidebar
N-isobutyl-6- 2-thienyl -2E,4E-hexadienamide
- Family: Plantae - Asteraceae
- Kingdom: Plantae
- Class: Amide
Canonical Smiles | CC(CNC(=O)/C=C/C=C/Cc1cccs1)C |
---|---|
InChI | InChI=1S/C14H19NOS/c1-12(2)11-15-14(16)9-5-3-4-7-13-8-6-10-17-13/h3-6,8-10,12H,7,11H2,1-2H3,(H,15,16)/b4-3+,9-5+ |
InChIKey | KNGBXFMEGLRFHV-PRKJJMSOSA-N |
Formula | C14H19NOS |
HBA | 2 |
HBD | 1 |
MW | 249.38 |
Rotatable Bonds | 6 |
TPSA | 29.1 |
LogP | 3.18 |
Number Rings | 1 |
Number Aromatic Rings | 1 |
Heavy Atom Count | 17 |
Formal Charge | 0 |
Fraction CSP3 | 0.36 |
Exact Mass | 249.12 |
Number of Lipinski Rule Violations | 0 |
# | Species | Family | Kingdom | NCBI Taxonomy ID |
---|---|---|---|---|
1 | Chrysanthemum morifolium | Asteraceae | Plantae | 41568 |
2 | Matricaria pubescens | Asteraceae | Plantae | 99022 |
Showing of synonyms
N-isobutyl-6- 2-thienyl -2E,4E-hexadienamide
32514-01-5
(2E,4E)-N-Isobutyl-6-(2-thienyl)hexa-2,4-dienamide
(2E,4E)-N-(2-methylpropyl)-6-thiophen-2-ylhexa-2,4-dienamide
6-(2-Thienyl)-2,4-hexadienoic acid isobutylamide
MEGxp0_001540
SCHEMBL10594484
AKOS040735070
(2E,4E)-N-Isobutyl-6-(thiophen-2-yl)hexa-2,4-dienamide
Pubchem:
14776997
Cas:
32514-01-5
Gnps:
CCMSLIB00004714352
Zinc:
ZINC000031165717
Nmrshiftdb2:
60075053
No compound-protein relationship available.
SMILES: c1ccsc1
Level: 0
Mol. Weight: 249.38 g/mol
No bioactivities available.
Absorption
- Caco-2 (logPapp)
- -4.42
- Human Oral Bioavailability 20%
- Bioavailable
- Human Intestinal Absorption
- Absorbed
- Madin-Darby Canine Kidney
- -3.86
- Human Oral Bioavailability 50%
- Bioavailable
- P-Glycoprotein Inhibitor
- Non-Inhibitor
- P-Glycoprotein Substrate
- Non-Substrate
- Skin Permeability
- -2.7
Distribution
- Blood-Brain Barrier (CNS)
- -
- Blood-Brain Barrier
- Penetrable
- Fraction Unbound (Human)
- 0.96
- Plasma Protein Binding
- 52.78
- Steady State Volume of Distribution
- -
Metabolism
- Breast Cancer Resistance Protein
- Non-Inhibitor
- CYP 1A2 Inhibitor
- Inhibitor
- CYP 1A2 Substrate
- Non-Substrate
- CYP 2C19 Inhibitor
- Non-Inhibitor
- CYP 2C19 Substrate
- Substrate
- CYP 2C9 Inhibitor
- Inhibitor
- CYP 2C9 Substrate
- Substrate
- CYP 2D6 Inhibitor
- Non-Inhibitor
- CYP 2D6 Substrate
- Substrate
- CYP 3A4 Inhibitor
- Non-Inhibitor
- CYP 3A4 Substrate
- Non-Substrate
- OATP1B1
- Non-Inhibitor
- OATP1B3
- Non-Inhibitor
Excretion
- Clearance
- 3.94
- Organic Cation Transporter 2
- Non-Inhibitor
- Half-Life of Drug
- -
Toxicity
- AMES Mutagenesis
- Safe
- Avian
- Safe
- Bee
- Safe
- Bioconcentration Factor
- 1.7
- Biodegradation
- Safe
- Carcinogenesis
- Safe
- Crustacean
- Toxic
- Liver Injury I (DILI)
- Safe
- Eye Corrosion
- Safe
- Eye Irritation
- Safe
- Maximum Tolerated Dose
- 0.08
- Liver Injury II
- Toxic
- hERG Blockers
- Safe
- Daphnia Maga
- 4.92
- Micronucleos
- Toxic
- NR-AhR
- Safe
- NR-AR
- Safe
- NR-AR-LBD
- Safe
- NR-Aromatase
- Safe
- NR-ER
- Safe
- NR-ER-LBD
- Safe
- NR-GR
- Safe
- NR-PPAR-gamma
- Safe
- NR-TR
- Safe
- T. Pyriformis
- 4.85
- Rat (Acute)
- 2.31
- Rat (Chronic Oral)
- 1.67
- Fathead Minnow
- 4.78
- Respiratory Disease
- Toxic
- Skin Sensitisation
- Toxic
- SR-ARE
- Toxic
- SR-ATAD5
- Safe
- SR-HSE
- Safe
- SR-MMP
- Safe
- SR-p53
- Safe
General Properties
- Boiling Point
- 320.72
- Hydration Free Energy
- -9.24
- Log(D) at pH=7.4
- 3.03
- Log(P)
- 3.61
- Log S
- -3.56
- Log(Vapor Pressure)
- -5.12
- Melting Point
- 92.21
- pKa Acid
- 10.39
- pKa Basic
- 4.09
Protein Name | UniProt ID | Entry Name | Species | #Pharmacophore Points | Probability (0.7 ≤ Tversky Score ≤ 1.0) |
---|---|---|---|---|---|
Cathepsin S | P25774 | CATS_HUMAN | Homo sapiens | 3 | 0.9782 |
Cathepsin S | P25774 | CATS_HUMAN | Homo sapiens | 3 | 0.9782 |
Prolyl endopeptidase | P23687 | PPCE_PIG | Sus scrofa | 3 | 0.9118 |
Prolyl endopeptidase | P23687 | PPCE_PIG | Sus scrofa | 3 | 0.9118 |
ADP-ribosylation factor 1 | P84077 | ARF1_HUMAN | Homo sapiens | 2 | 0.8439 |
ADP-ribosylation factor 1 | P84077 | ARF1_HUMAN | Homo sapiens | 2 | 0.8439 |
Macrophage metalloelastase | P39900 | MMP12_HUMAN | Homo sapiens | 3 | 0.8323 |
Macrophage metalloelastase | P39900 | MMP12_HUMAN | Homo sapiens | 3 | 0.8323 |
Aldo-keto reductase family 1 member C3 | P42330 | AK1C3_HUMAN | Homo sapiens | 2 | 0.8234 |
Aldo-keto reductase family 1 member C3 | P42330 | AK1C3_HUMAN | Homo sapiens | 2 | 0.8234 |
2-aminohexano-6-lactam racemase | Q7M181 | ACLR_ACHOB | Achromobacter obae | 3 | 0.8007 |
2-aminohexano-6-lactam racemase | Q7M181 | ACLR_ACHOB | Achromobacter obae | 3 | 0.8007 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7750 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7750 |
Avd protein | A7YYL1 | A7YYL1_XENTR | Xenopus tropicalis | 3 | 0.7713 |
Avd protein | A7YYL1 | A7YYL1_XENTR | Xenopus tropicalis | 3 | 0.7713 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 3 | 0.7706 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 3 | 0.7706 |
Avidin | P02701 | AVID_CHICK | Gallus gallus | 3 | 0.7705 |
Avidin | P02701 | AVID_CHICK | Gallus gallus | 3 | 0.7705 |
prolyl oligopeptidase | Q9X6R4 | Q9X6R4_AERCA | Aeromonas caviae | 2 | 0.7692 |
prolyl oligopeptidase | Q9X6R4 | Q9X6R4_AERCA | Aeromonas caviae | 2 | 0.7692 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7611 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7611 |
Sex hormone-binding globulin | P04278 | SHBG_HUMAN | Homo sapiens | 2 | 0.7601 |
Sex hormone-binding globulin | P04278 | SHBG_HUMAN | Homo sapiens | 2 | 0.7601 |
Peptidyl-prolyl cis-trans isomerase FKBP1A | P62942 | FKB1A_HUMAN | Homo sapiens | 3 | 0.7547 |
Peptidyl-prolyl cis-trans isomerase FKBP1A | P62942 | FKB1A_HUMAN | Homo sapiens | 3 | 0.7547 |
Type IV / VI secretion system DotU domain-containing protein | Q9KN50 | Q9KN50_VIBCH | Vibrio cholerae serotype O1 | 2 | 0.7538 |
Type IV / VI secretion system DotU domain-containing protein | Q9KN50 | Q9KN50_VIBCH | Vibrio cholerae serotype O1 | 2 | 0.7538 |
Alpha/beta hydrolase fold protein | D2J2T6 | D2J2T6_9RHIZ | Ochrobactrum sp. T63 | 3 | 0.7481 |
Alpha/beta hydrolase fold protein | D2J2T6 | D2J2T6_9RHIZ | Ochrobactrum sp. T63 | 3 | 0.7481 |
Sodium-dependent dopamine transporter | Q7K4Y6 | DAT_DROME | Drosophila melanogaster | 2 | 0.7480 |
Sodium-dependent dopamine transporter | Q7K4Y6 | DAT_DROME | Drosophila melanogaster | 2 | 0.7480 |
Vitamin D-binding protein | P02774 | VTDB_HUMAN | Homo sapiens | 2 | 0.7474 |
Vitamin D-binding protein | P02774 | VTDB_HUMAN | Homo sapiens | 2 | 0.7474 |
Glucan 1,3-beta-glucosidase | P29717 | EXG1_CANAL | Candida albicans | 2 | 0.7454 |
Glucan 1,3-beta-glucosidase | P29717 | EXG1_CANAL | Candida albicans | 2 | 0.7454 |
ATP-dependent molecular chaperone HSP82 | P02829 | HSP82_YEAST | Saccharomyces cerevisiae | 2 | 0.7443 |
ATP-dependent molecular chaperone HSP82 | P02829 | HSP82_YEAST | Saccharomyces cerevisiae | 2 | 0.7443 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7432 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7432 |
Dipeptidyl peptidase 4 | P14740 | DPP4_RAT | Rattus norvegicus | 2 | 0.7381 |
Dipeptidyl peptidase 4 | P14740 | DPP4_RAT | Rattus norvegicus | 2 | 0.7381 |
Photosynthetic reaction center cytochrome c subunit | P07173 | CYCR_BLAVI | Blastochloris viridis | 2 | 0.7343 |
Photosynthetic reaction center cytochrome c subunit | P07173 | CYCR_BLAVI | Blastochloris viridis | 2 | 0.7343 |
ADP-ribosylation factor 1 | P84080 | ARF1_BOVIN | Bos taurus | 2 | 0.7340 |
ADP-ribosylation factor 1 | P84080 | ARF1_BOVIN | Bos taurus | 2 | 0.7340 |
Mitogen-activated protein kinase 1 | P28482 | MK01_HUMAN | Homo sapiens | 2 | 0.7323 |
Mitogen-activated protein kinase 1 | P28482 | MK01_HUMAN | Homo sapiens | 2 | 0.7323 |
Dipeptidyl peptidase 4 | P27487 | DPP4_HUMAN | Homo sapiens | 2 | 0.7316 |
Dipeptidyl peptidase 4 | P27487 | DPP4_HUMAN | Homo sapiens | 2 | 0.7316 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 3 | 0.7295 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 3 | 0.7295 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 3 | 0.7287 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 3 | 0.7287 |
Methionine aminopeptidase 1 | P53582 | MAP11_HUMAN | Homo sapiens | 2 | 0.7279 |
Methionine aminopeptidase 1 | P53582 | MAP11_HUMAN | Homo sapiens | 2 | 0.7279 |
Chorismate mutase AroH | P19080 | AROH_BACSU | Bacillus subtilis | 2 | 0.7271 |
Chorismate mutase AroH | P19080 | AROH_BACSU | Bacillus subtilis | 2 | 0.7271 |
Endoplasmin | P41148 | ENPL_CANLF | Canis lupus familiaris | 2 | 0.7250 |
Endoplasmin | P41148 | ENPL_CANLF | Canis lupus familiaris | 2 | 0.7250 |
Protein claret segregational | P20480 | NCD_DROME | Drosophila melanogaster | 2 | 0.7243 |
Protein claret segregational | P20480 | NCD_DROME | Drosophila melanogaster | 2 | 0.7243 |
11-beta-hydroxysteroid dehydrogenase 1 | P28845 | DHI1_HUMAN | Homo sapiens | 2 | 0.7231 |
11-beta-hydroxysteroid dehydrogenase 1 | P28845 | DHI1_HUMAN | Homo sapiens | 2 | 0.7231 |
Avidin | P02701 | AVID_CHICK | Gallus gallus | 2 | 0.7228 |
Avidin | P02701 | AVID_CHICK | Gallus gallus | 2 | 0.7228 |
Prolyl tripeptidyl peptidase | Q7MUW6 | PTP_PORGI | Porphyromonas gingivalis | 2 | 0.7221 |
Prolyl tripeptidyl peptidase | Q7MUW6 | PTP_PORGI | Porphyromonas gingivalis | 2 | 0.7221 |
Genome polyprotein | O92972 | POLG_HCVJ4 | Hepatitis C virus genotype 1b | 2 | 0.7208 |
Genome polyprotein | O92972 | POLG_HCVJ4 | Hepatitis C virus genotype 1b | 2 | 0.7208 |
Phosphotriesterase | Q5KZU5 | Q5KZU5_GEOKA | Geobacillus kaustophilus | 2 | 0.7195 |
Phosphotriesterase | Q5KZU5 | Q5KZU5_GEOKA | Geobacillus kaustophilus | 2 | 0.7195 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7181 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7181 |
Cytochrome P450 | Q93H81 | Q93H81_STRAX | Streptomyces avermitilis | 2 | 0.7171 |
Cytochrome P450 | Q93H81 | Q93H81_STRAX | Streptomyces avermitilis | 2 | 0.7171 |
Liver carboxylesterase 1 | P23141 | EST1_HUMAN | Homo sapiens | 2 | 0.7159 |
Liver carboxylesterase 1 | P23141 | EST1_HUMAN | Homo sapiens | 2 | 0.7159 |
Transcriptional activator, LuxR/UhpA family of regulators | Q7NQP7 | Q7NQP7_CHRVO | Chromobacterium violaceum | 2 | 0.7158 |
Transcriptional activator, LuxR/UhpA family of regulators | Q7NQP7 | Q7NQP7_CHRVO | Chromobacterium violaceum | 2 | 0.7158 |
Trichothecene 15-O-acetyltransferase TRI3 | Q9C1B7 | TRI3_FUSSP | Fusarium sporotrichioides | 2 | 0.7123 |
Trichothecene 15-O-acetyltransferase TRI3 | Q9C1B7 | TRI3_FUSSP | Fusarium sporotrichioides | 2 | 0.7123 |
Transcriptional activator, LuxR/UhpA family of regulators | Q7NQP7 | Q7NQP7_CHRVO | Chromobacterium violaceum | 2 | 0.7120 |
Transcriptional activator, LuxR/UhpA family of regulators | Q7NQP7 | Q7NQP7_CHRVO | Chromobacterium violaceum | 2 | 0.7120 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7114 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7114 |
Dihydrofolate reductase | P00378 | DYR_CHICK | Gallus gallus | 2 | 0.7104 |
Dihydrofolate reductase | P00378 | DYR_CHICK | Gallus gallus | 2 | 0.7104 |
Amino-acid acetyltransferase | Q5FAK7 | Q5FAK7_NEIG1 | Neisseria gonorrhoeae | 2 | 0.7089 |
Amino-acid acetyltransferase | Q5FAK7 | Q5FAK7_NEIG1 | Neisseria gonorrhoeae | 2 | 0.7089 |
N-acyl-aromatic-L-amino acid amidohydrolase (carboxylate-forming) | Q91XE4 | ACY3_MOUSE | Mus musculus | 2 | 0.7082 |
N-acyl-aromatic-L-amino acid amidohydrolase (carboxylate-forming) | Q91XE4 | ACY3_MOUSE | Mus musculus | 2 | 0.7082 |
Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial | Q0QF01 | SDHA_PIG | Sus scrofa | 2 | 0.7076 |
Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial | Q0QF01 | SDHA_PIG | Sus scrofa | 2 | 0.7076 |
Flavin-dependent monooxygenase | Q93L51 | TETX_BACT4 | Bacteroides thetaiotaomicron | 2 | 0.7065 |
Flavin-dependent monooxygenase | Q93L51 | TETX_BACT4 | Bacteroides thetaiotaomicron | 2 | 0.7065 |
Avidin | P02701 | AVID_CHICK | Gallus gallus | 2 | 0.7057 |
Avidin | P02701 | AVID_CHICK | Gallus gallus | 2 | 0.7057 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 2 | 0.7053 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 2 | 0.7053 |
Carboxypeptidase A1 | P00730 | CBPA1_BOVIN | Bos taurus | 2 | 0.7042 |
Carboxypeptidase A1 | P00730 | CBPA1_BOVIN | Bos taurus | 2 | 0.7042 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 2 | 0.7028 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 2 | 0.7028 |
3-alpha-(or 20-beta)-hydroxysteroid dehydrogenase | P19992 | HSD_STREX | Streptomyces exfoliatus | 2 | 0.7021 |
3-alpha-(or 20-beta)-hydroxysteroid dehydrogenase | P19992 | HSD_STREX | Streptomyces exfoliatus | 2 | 0.7021 |