Select a section from the left sidebar
N1,N8-dibenzoylspermidine
- Family: Plantae - Leguminosae/Fabaceae
- Kingdom: Plantae
- Class: Quinone
Canonical Smiles | O=C(c1ccccc1)NCCCCNCCCNC(=O)c1ccccc1 |
---|---|
InChI | InChI=1S/C21H27N3O2/c25-20(18-10-3-1-4-11-18)23-16-8-7-14-22-15-9-17-24-21(26)19-12-5-2-6-13-19/h1-6,10-13,22H,7-9,14-17H2,(H,23,25)(H,24,26) |
InChIKey | LMCPFFPDMJWFKE-UHFFFAOYSA-N |
Formula | C21H27N3O2 |
HBA | 3 |
HBD | 3 |
MW | 353.47 |
Rotatable Bonds | 11 |
TPSA | 70.23 |
LogP | 2.61 |
Number Rings | 2 |
Number Aromatic Rings | 2 |
Heavy Atom Count | 26 |
Formal Charge | 0 |
Fraction CSP3 | 0.33 |
Exact Mass | 353.21 |
Number of Lipinski Rule Violations | 0 |
# | Species | Family | Kingdom | NCBI Taxonomy ID |
---|---|---|---|---|
1 | Cassia floribunda | Leguminosae/Fabaceae | Plantae | 2601732 |
Showing of synonyms
N1,N8-dibenzoylspermidine
Not Available
ChiRYun
N-[4-(3-benzamidopropylamino)butyl]benzamide
NSC685963
CHEMBL58301
BDBM50184771
NSC-685963
NCI60_030945
1N-[3-(4-phenylcarboxamidobutylamino)propyl]benzamide
N-(3-((4-(Benzoylamino)butyl)amino)propyl)benzamide
No compound-protein relationship available.
SMILES: c1ccccc1C(=O)NCCCCNCCCNC(=O)c2ccccc2
Level: 1
Mol. Weight: 353.47 g/mol
SMILES: c1ccccc1
Level: 0
Mol. Weight: 353.47 g/mol
No bioactivities available.
Absorption
- Caco-2 (logPapp)
- -5.4
- Human Oral Bioavailability 20%
- Bioavailable
- Human Intestinal Absorption
- Absorbed
- Madin-Darby Canine Kidney
- -4.37
- Human Oral Bioavailability 50%
- Bioavailable
- P-Glycoprotein Inhibitor
- Non-Inhibitor
- P-Glycoprotein Substrate
- Substrate
- Skin Permeability
- -2.94
Distribution
- Blood-Brain Barrier (CNS)
- -
- Blood-Brain Barrier
- Penetrable
- Fraction Unbound (Human)
- 1.06
- Plasma Protein Binding
- 53.23
- Steady State Volume of Distribution
- -
Metabolism
- Breast Cancer Resistance Protein
- Non-Inhibitor
- CYP 1A2 Inhibitor
- Inhibitor
- CYP 1A2 Substrate
- Non-Substrate
- CYP 2C19 Inhibitor
- Non-Inhibitor
- CYP 2C19 Substrate
- Non-Substrate
- CYP 2C9 Inhibitor
- Non-Inhibitor
- CYP 2C9 Substrate
- Non-Substrate
- CYP 2D6 Inhibitor
- Non-Inhibitor
- CYP 2D6 Substrate
- Substrate
- CYP 3A4 Inhibitor
- Non-Inhibitor
- CYP 3A4 Substrate
- Non-Substrate
- OATP1B1
- Non-Inhibitor
- OATP1B3
- Non-Inhibitor
Excretion
- Clearance
- 8.54
- Organic Cation Transporter 2
- Non-Inhibitor
- Half-Life of Drug
- -
Toxicity
- AMES Mutagenesis
- Toxic
- Avian
- Safe
- Bee
- Safe
- Bioconcentration Factor
- 0.19
- Biodegradation
- Safe
- Carcinogenesis
- Safe
- Crustacean
- Toxic
- Liver Injury I (DILI)
- Safe
- Eye Corrosion
- Safe
- Eye Irritation
- Safe
- Maximum Tolerated Dose
- 0.47
- Liver Injury II
- Safe
- hERG Blockers
- Safe
- Daphnia Maga
- 4.64
- Micronucleos
- Toxic
- NR-AhR
- Safe
- NR-AR
- Safe
- NR-AR-LBD
- Safe
- NR-Aromatase
- Safe
- NR-ER
- Safe
- NR-ER-LBD
- Safe
- NR-GR
- Safe
- NR-PPAR-gamma
- Safe
- NR-TR
- Safe
- T. Pyriformis
- -1.99
- Rat (Acute)
- 2.2
- Rat (Chronic Oral)
- 1.83
- Fathead Minnow
- 3.99
- Respiratory Disease
- Safe
- Skin Sensitisation
- Safe
- SR-ARE
- Safe
- SR-ATAD5
- Safe
- SR-HSE
- Safe
- SR-MMP
- Safe
- SR-p53
- Safe
General Properties
- Boiling Point
- 430.72
- Hydration Free Energy
- -9.4
- Log(D) at pH=7.4
- 1.33
- Log(P)
- 1.56
- Log S
- -3.03
- Log(Vapor Pressure)
- -9.02
- Melting Point
- 118.26
- pKa Acid
- 8.95
- pKa Basic
- 9.35
Protein Name | UniProt ID | Entry Name | Species | #Pharmacophore Points | Probability (0.7 ≤ Tversky Score ≤ 1.0) |
---|---|---|---|---|---|
Polyamine oxidase FMS1 | P50264 | FMS1_YEAST | Saccharomyces cerevisiae | 3 | 0.9857 |
Polyamine oxidase FMS1 | P50264 | FMS1_YEAST | Saccharomyces cerevisiae | 3 | 0.9857 |
Thermolysin | P00800 | THER_BACTH | Bacillus thermoproteolyticus | 3 | 0.9777 |
Thermolysin | P00800 | THER_BACTH | Bacillus thermoproteolyticus | 3 | 0.9777 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.9686 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.9686 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 3 | 0.9604 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 3 | 0.9604 |
3-hydroxydecanoyl-[acyl-carrier-protein] dehydratase | O33877 | FABA_PSEAE | Pseudomonas aeruginosa | 3 | 0.9541 |
3-hydroxydecanoyl-[acyl-carrier-protein] dehydratase | O33877 | FABA_PSEAE | Pseudomonas aeruginosa | 3 | 0.9541 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 3 | 0.9532 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 3 | 0.9532 |
Thermolysin | P00800 | THER_BACTH | Bacillus thermoproteolyticus | 3 | 0.9486 |
Thermolysin | P00800 | THER_BACTH | Bacillus thermoproteolyticus | 3 | 0.9486 |
Nuclear receptor subfamily 4immunitygroup A member 1 | P22736 | NR4A1_HUMAN | Homo sapiens | 3 | 0.9416 |
Nuclear receptor subfamily 4immunitygroup A member 1 | P22736 | NR4A1_HUMAN | Homo sapiens | 3 | 0.9416 |
Lactoperoxidase | A0A452E9Y6 | PERL_CAPHI | Capra hircus | 3 | 0.9411 |
Lactoperoxidase | A0A452E9Y6 | PERL_CAPHI | Capra hircus | 3 | 0.9411 |
Glycogen synthase kinase-3 beta | P49841 | GSK3B_HUMAN | Homo sapiens | 3 | 0.9392 |
Glycogen synthase kinase-3 beta | P49841 | GSK3B_HUMAN | Homo sapiens | 3 | 0.9392 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.9382 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.9382 |
Protein mono-ADP-ribosyltransferase PARP3 | Q9Y6F1 | PARP3_HUMAN | Homo sapiens | 3 | 0.9371 |
Protein mono-ADP-ribosyltransferase PARP3 | Q9Y6F1 | PARP3_HUMAN | Homo sapiens | 3 | 0.9371 |
Nicotinamide phosphoribosyltransferase | P43490 | NAMPT_HUMAN | Homo sapiens | 3 | 0.9365 |
Nicotinamide phosphoribosyltransferase | P43490 | NAMPT_HUMAN | Homo sapiens | 3 | 0.9365 |
LIM domain kinase 1 | P53667 | LIMK1_HUMAN | Homo sapiens | 3 | 0.9317 |
LIM domain kinase 1 | P53667 | LIMK1_HUMAN | Homo sapiens | 3 | 0.9317 |
ADP compounds hydrolase NudE | P45799 | NUDE_ECOLI | Escherichia coli | 3 | 0.9288 |
ADP compounds hydrolase NudE | P45799 | NUDE_ECOLI | Escherichia coli | 3 | 0.9288 |
Poly [ADP-ribose] polymerase tankyrase-2 | Q9H2K2 | TNKS2_HUMAN | Homo sapiens | 3 | 0.9252 |
Poly [ADP-ribose] polymerase tankyrase-2 | Q9H2K2 | TNKS2_HUMAN | Homo sapiens | 3 | 0.9252 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 3 | 0.9235 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 3 | 0.9235 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 3 | 0.9216 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 3 | 0.9216 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.9209 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.9209 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.9207 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.9207 |
5'-methylthioadenosine/S-adenosylhomocysteine nucleosidase | P0AF12 | MTNN_ECOLI | Escherichia coli | 3 | 0.9201 |
5'-methylthioadenosine/S-adenosylhomocysteine nucleosidase | P0AF12 | MTNN_ECOLI | Escherichia coli | 3 | 0.9201 |
Casein kinase II subunit alpha | P68400 | CSK21_HUMAN | Homo sapiens | 3 | 0.9198 |
Casein kinase II subunit alpha | P68400 | CSK21_HUMAN | Homo sapiens | 3 | 0.9198 |
L-lactate dehydrogenase A chain | P04642 | LDHA_RAT | Rattus norvegicus | 3 | 0.9187 |
L-lactate dehydrogenase A chain | P04642 | LDHA_RAT | Rattus norvegicus | 3 | 0.9187 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.9181 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.9181 |
RIO-type serine/threonine-protein kinase Rio1 | O28471 | RIO1_ARCFU | Archaeoglobus fulgidus | 3 | 0.9168 |
RIO-type serine/threonine-protein kinase Rio1 | O28471 | RIO1_ARCFU | Archaeoglobus fulgidus | 3 | 0.9168 |
cAMP-dependent protein kinase catalytic subunit alpha | P05132 | KAPCA_MOUSE | Mus musculus | 3 | 0.9165 |
cAMP-dependent protein kinase catalytic subunit alpha | P05132 | KAPCA_MOUSE | Mus musculus | 3 | 0.9165 |
Protein mono-ADP-ribosyltransferase PARP14 | Q460N5 | PAR14_HUMAN | Homo sapiens | 3 | 0.9148 |
Protein mono-ADP-ribosyltransferase PARP14 | Q460N5 | PAR14_HUMAN | Homo sapiens | 3 | 0.9148 |
Capsid protein | Q9WBP8 | Q9WBP8_9VIRU | Adeno-associated virus - 1 | 3 | 0.9141 |
Capsid protein | Q9WBP8 | Q9WBP8_9VIRU | Adeno-associated virus - 1 | 3 | 0.9141 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.9141 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.9141 |
Serine/threonine-protein kinase toxin HipA | P23874 | HIPA_ECOLI | Escherichia coli | 3 | 0.9140 |
Serine/threonine-protein kinase toxin HipA | P23874 | HIPA_ECOLI | Escherichia coli | 3 | 0.9140 |
Biotin carboxylase | P24182 | ACCC_ECOLI | Escherichia coli | 3 | 0.9136 |
Biotin carboxylase | P24182 | ACCC_ECOLI | Escherichia coli | 3 | 0.9136 |
Prolyl endopeptidase | P23687 | PPCE_PIG | Sus scrofa | 3 | 0.9134 |
Prolyl endopeptidase | P23687 | PPCE_PIG | Sus scrofa | 3 | 0.9134 |
Biotin carboxylase | P43873 | ACCC_HAEIN | Haemophilus influenzae | 3 | 0.9130 |
Biotin carboxylase | P43873 | ACCC_HAEIN | Haemophilus influenzae | 3 | 0.9130 |
Lactoperoxidase | P80025 | PERL_BOVIN | Bos taurus | 3 | 0.9123 |
Lactoperoxidase | P80025 | PERL_BOVIN | Bos taurus | 3 | 0.9123 |
Serine/threonine-protein kinase SKY1 | Q03656 | SKY1_YEAST | Saccharomyces cerevisiae | 3 | 0.9106 |
Serine/threonine-protein kinase SKY1 | Q03656 | SKY1_YEAST | Saccharomyces cerevisiae | 3 | 0.9106 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.9102 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.9102 |
Chloramphenicol 3-O phosphotransferase | Q56148 | CPT_STRVP | Streptomyces venezuelae | 3 | 0.9101 |
Chloramphenicol 3-O phosphotransferase | Q56148 | CPT_STRVP | Streptomyces venezuelae | 3 | 0.9101 |
ATP-dependent molecular chaperone HSP82 | P02829 | HSP82_YEAST | Saccharomyces cerevisiae | 3 | 0.9084 |
Protein kinase C iota type | Q62074 | KPCI_MOUSE | Mus musculus | 3 | 0.9084 |
Protein kinase C iota type | Q62074 | KPCI_MOUSE | Mus musculus | 3 | 0.9084 |
ATP-dependent molecular chaperone HSP82 | P02829 | HSP82_YEAST | Saccharomyces cerevisiae | 3 | 0.9084 |
Mitogen-activated protein kinase kinase kinase 5 | Q99683 | M3K5_HUMAN | Homo sapiens | 3 | 0.9070 |
Mitogen-activated protein kinase kinase kinase 5 | Q99683 | M3K5_HUMAN | Homo sapiens | 3 | 0.9070 |
Protein mono-ADP-ribosyltransferase PARP10 | Q53GL7 | PAR10_HUMAN | Homo sapiens | 3 | 0.9066 |
Protein mono-ADP-ribosyltransferase PARP10 | Q53GL7 | PAR10_HUMAN | Homo sapiens | 3 | 0.9066 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 3 | 0.9063 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 3 | 0.9063 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.9054 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.9054 |
Poly [ADP-ribose] polymerase tankyrase-2 | Q9H2K2 | TNKS2_HUMAN | Homo sapiens | 3 | 0.9033 |
Poly [ADP-ribose] polymerase tankyrase-2 | Q9H2K2 | TNKS2_HUMAN | Homo sapiens | 3 | 0.9033 |
Myosin heavy chain kinase A | P42527 | MHCKA_DICDI | Dictyostelium discoideum | 3 | 0.9025 |
Basic phospholipase A2 VRV-PL-VIIIa | P59071 | PA2B8_DABRR | Daboia russelii | 3 | 0.9025 |
Basic phospholipase A2 VRV-PL-VIIIa | P59071 | PA2B8_DABRR | Daboia russelii | 3 | 0.9025 |
Myosin heavy chain kinase A | P42527 | MHCKA_DICDI | Dictyostelium discoideum | 3 | 0.9025 |
Nitric oxide synthase 3 | P29474 | NOS3_HUMAN | Homo sapiens | 3 | 0.8998 |
Nitric oxide synthase 3 | P29474 | NOS3_HUMAN | Homo sapiens | 3 | 0.8998 |
NAD-dependent protein deacetylase | Q9WYW0 | NPD_THEMA | Thermotoga maritima | 3 | 0.8992 |
NAD-dependent protein deacetylase | Q9WYW0 | NPD_THEMA | Thermotoga maritima | 3 | 0.8992 |
Camphor 5-monooxygenase | P00183 | CPXA_PSEPU | Pseudomonas putida | 3 | 0.8960 |
Camphor 5-monooxygenase | P00183 | CPXA_PSEPU | Pseudomonas putida | 3 | 0.8960 |
Poly [ADP-ribose] polymerase tankyrase-2 | Q9H2K2 | TNKS2_HUMAN | Homo sapiens | 3 | 0.8957 |
Poly [ADP-ribose] polymerase tankyrase-2 | Q9H2K2 | TNKS2_HUMAN | Homo sapiens | 3 | 0.8957 |
clade A/E 93TH057 HIV-1 gp120 core | A0A0M3KKW9 | A0A0M3KKW9_9HIV1 | Human immunodeficiency virus 1 | 3 | 0.8952 |
clade A/E 93TH057 HIV-1 gp120 core | A0A0M3KKW9 | A0A0M3KKW9_9HIV1 | Human immunodeficiency virus 1 | 3 | 0.8952 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.8948 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.8948 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 3 | 0.8942 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 3 | 0.8942 |
Ephrin type-B receptor 2 | P54763 | EPHB2_MOUSE | Mus musculus | 3 | 0.8928 |
Ephrin type-B receptor 2 | P54763 | EPHB2_MOUSE | Mus musculus | 3 | 0.8928 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.8919 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.8919 |
Putative FAD-dependent oxygenase EncM | Q9KHK2 | Q9KHK2_9ACTN | Streptomyces maritimus | 3 | 0.8867 |
Putative FAD-dependent oxygenase EncM | Q9KHK2 | Q9KHK2_9ACTN | Streptomyces maritimus | 3 | 0.8867 |
Lactotransferrin | P24627 | TRFL_BOVIN | Bos taurus | 3 | 0.8852 |
Lactotransferrin | P24627 | TRFL_BOVIN | Bos taurus | 3 | 0.8852 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.8841 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.8841 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.8791 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.8791 |
Diphtheria toxin | P00588 | DTX_CORBE | Corynephage beta | 3 | 0.8787 |
Diphtheria toxin | P00588 | DTX_CORBE | Corynephage beta | 3 | 0.8787 |
ADP-ribosylation factor 1 | P84077 | ARF1_HUMAN | Homo sapiens | 2 | 0.8746 |
ADP-ribosylation factor 1 | P84077 | ARF1_HUMAN | Homo sapiens | 2 | 0.8746 |
Cytokinin dehydrogenase 1 | Q9T0N8 | CKX1_MAIZE | Zea mays | 3 | 0.8728 |
Cytokinin dehydrogenase 1 | Q9T0N8 | CKX1_MAIZE | Zea mays | 3 | 0.8728 |
Cytochrome P450 2A6 | P11509 | CP2A6_HUMAN | Homo sapiens | 3 | 0.8723 |
Cytochrome P450 2A6 | P11509 | CP2A6_HUMAN | Homo sapiens | 3 | 0.8723 |
Mitogen-activated protein kinase 1 | P28482 | MK01_HUMAN | Homo sapiens | 3 | 0.8710 |
Mitogen-activated protein kinase 1 | P28482 | MK01_HUMAN | Homo sapiens | 3 | 0.8710 |
Pancreatic alpha-amylase | P04746 | AMYP_HUMAN | Homo sapiens | 3 | 0.8671 |
Pancreatic alpha-amylase | P04746 | AMYP_HUMAN | Homo sapiens | 3 | 0.8671 |
Serine/threonine-protein kinase Chk1 | O14757 | CHK1_HUMAN | Homo sapiens | 3 | 0.8641 |
Serine/threonine-protein kinase Chk1 | O14757 | CHK1_HUMAN | Homo sapiens | 3 | 0.8641 |
Ceramide transfer protein | Q9Y5P4 | CERT_HUMAN | Homo sapiens | 3 | 0.8607 |
Ceramide transfer protein | Q9Y5P4 | CERT_HUMAN | Homo sapiens | 3 | 0.8607 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.8597 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.8597 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.8554 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.8554 |
cAMP-dependent protein kinase catalytic subunit alpha | P00517 | KAPCA_BOVIN | Bos taurus | 3 | 0.8547 |
cAMP-dependent protein kinase catalytic subunit alpha | P00517 | KAPCA_BOVIN | Bos taurus | 3 | 0.8547 |
rRNA methylase | Q8DSS3 | Q8DSS3_STRMU | Streptococcus mutans serotype c | 2 | 0.8530 |
rRNA methylase | Q8DSS3 | Q8DSS3_STRMU | Streptococcus mutans serotype c | 2 | 0.8530 |
Insulin-degrading enzyme | P14735 | IDE_HUMAN | Homo sapiens | 3 | 0.8528 |
Insulin-degrading enzyme | P14735 | IDE_HUMAN | Homo sapiens | 3 | 0.8528 |
Liver carboxylesterase 1 | P23141 | EST1_HUMAN | Homo sapiens | 3 | 0.8486 |
Liver carboxylesterase 1 | P23141 | EST1_HUMAN | Homo sapiens | 3 | 0.8486 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 4 | 0.8362 |
Poly [ADP-ribose] polymerase 1 | P09874 | PARP1_HUMAN | Homo sapiens | 4 | 0.8362 |
Chloramphenicol 3-O phosphotransferase | Q56148 | CPT_STRVP | Streptomyces venezuelae | 3 | 0.8342 |
Chloramphenicol 3-O phosphotransferase | Q56148 | CPT_STRVP | Streptomyces venezuelae | 3 | 0.8342 |
Gag-Pol polyprotein | P04587 | POL_HV1B5 | Human immunodeficiency virus type 1 group M subtype B | 4 | 0.8310 |
Gag-Pol polyprotein | P04587 | POL_HV1B5 | Human immunodeficiency virus type 1 group M subtype B | 4 | 0.8310 |
Stimulator of interferon genes protein | Q86WV6 | STING_HUMAN | Homo sapiens | 3 | 0.8266 |
Stimulator of interferon genes protein | Q86WV6 | STING_HUMAN | Homo sapiens | 3 | 0.8266 |
Cytochrome P450 | Q93H81 | Q93H81_STRAX | Streptomyces avermitilis | 3 | 0.8242 |
Cytochrome P450 | Q93H81 | Q93H81_STRAX | Streptomyces avermitilis | 3 | 0.8242 |
Purine nucleoside phosphorylase DeoD-type | P0ABP8 | DEOD_ECOLI | Escherichia coli | 3 | 0.8203 |
Purine nucleoside phosphorylase DeoD-type | P0ABP8 | DEOD_ECOLI | Escherichia coli | 3 | 0.8203 |
Basic phospholipase A2 VRV-PL-VIIIa | P59071 | PA2B8_DABRR | Daboia russelii | 2 | 0.8190 |
Basic phospholipase A2 VRV-PL-VIIIa | P59071 | PA2B8_DABRR | Daboia russelii | 2 | 0.8190 |
N-acetyltransferase domain-containing protein | Q9HV14 | Q9HV14_PSEAE | Pseudomonas aeruginosa | 2 | 0.8154 |
N-acetyltransferase domain-containing protein | Q9HV14 | Q9HV14_PSEAE | Pseudomonas aeruginosa | 2 | 0.8154 |
11-beta-hydroxysteroid dehydrogenase 1 | P28845 | DHI1_HUMAN | Homo sapiens | 3 | 0.8115 |
11-beta-hydroxysteroid dehydrogenase 1 | P28845 | DHI1_HUMAN | Homo sapiens | 3 | 0.8115 |
Class 10 plant pathogenesis-related protein 2B | Q9LLQ2 | P102B_LUPLU | Lupinus luteus | 2 | 0.8049 |
Class 10 plant pathogenesis-related protein 2B | Q9LLQ2 | P102B_LUPLU | Lupinus luteus | 2 | 0.8049 |
Amine oxidase [flavin-containing] B | P27338 | AOFB_HUMAN | Homo sapiens | 3 | 0.8044 |
Amine oxidase [flavin-containing] B | P27338 | AOFB_HUMAN | Homo sapiens | 3 | 0.8044 |
histone deacetylase | A5H660 | A5H660_SCHMA | Schistosoma mansoni | 3 | 0.7914 |
histone deacetylase | A5H660 | A5H660_SCHMA | Schistosoma mansoni | 3 | 0.7914 |
Regucalcin | Q64374 | RGN_MOUSE | Mus musculus | 3 | 0.7902 |
Regucalcin | Q64374 | RGN_MOUSE | Mus musculus | 3 | 0.7902 |
Dipeptidyl peptidase 4 | P27487 | DPP4_HUMAN | Homo sapiens | 3 | 0.7900 |
Dipeptidyl peptidase 4 | P27487 | DPP4_HUMAN | Homo sapiens | 3 | 0.7900 |
Indole-3-glycerol phosphate synthase | P9WFX7 | TRPC_MYCTU | Mycobacterium tuberculosis | 2 | 0.7890 |
Indole-3-glycerol phosphate synthase | P9WFX7 | TRPC_MYCTU | Mycobacterium tuberculosis | 2 | 0.7890 |
Disintegrin and metalloproteinase domain-containing protein 17 | P78536 | ADA17_HUMAN | Homo sapiens | 3 | 0.7882 |
Disintegrin and metalloproteinase domain-containing protein 17 | P78536 | ADA17_HUMAN | Homo sapiens | 3 | 0.7882 |
Camphor 5-monooxygenase | P00183 | CPXA_PSEPU | Pseudomonas putida | 3 | 0.7809 |
Camphor 5-monooxygenase | P00183 | CPXA_PSEPU | Pseudomonas putida | 3 | 0.7809 |
4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic | P49235 | HGGL1_MAIZE | Zea mays | 2 | 0.7800 |
4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic | P49235 | HGGL1_MAIZE | Zea mays | 2 | 0.7800 |
Gag-Pol polyprotein | P03366 | POL_HV1B1 | Human immunodeficiency virus type 1 group M subtype B | 3 | 0.7797 |
Gag-Pol polyprotein | P03366 | POL_HV1B1 | Human immunodeficiency virus type 1 group M subtype B | 3 | 0.7797 |
Type IV / VI secretion system DotU domain-containing protein | Q9KN50 | Q9KN50_VIBCH | Vibrio cholerae serotype O1 | 2 | 0.7786 |
Type IV / VI secretion system DotU domain-containing protein | Q9KN50 | Q9KN50_VIBCH | Vibrio cholerae serotype O1 | 2 | 0.7786 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 4 | 0.7777 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 4 | 0.7777 |
MAP kinase-activated protein kinase 2 | P49137 | MAPK2_HUMAN | Homo sapiens | 3 | 0.7759 |
MAP kinase-activated protein kinase 2 | P49137 | MAPK2_HUMAN | Homo sapiens | 3 | 0.7759 |
Beta-secretase 1 | P56817 | BACE1_HUMAN | Homo sapiens | 2 | 0.7742 |
Beta-secretase 1 | P56817 | BACE1_HUMAN | Homo sapiens | 2 | 0.7742 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.7722 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.7722 |
2',3'-cyclic-nucleotide 3'-phosphodiesterase | P16330 | CN37_MOUSE | Mus musculus | 2 | 0.7715 |
2',3'-cyclic-nucleotide 3'-phosphodiesterase | P16330 | CN37_MOUSE | Mus musculus | 2 | 0.7715 |
Tetracycline repressor protein class H | P51561 | TETR8_PASMD | Pasteurella multocida | 2 | 0.7708 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.7708 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 3 | 0.7708 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.7708 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 3 | 0.7708 |
Tetracycline repressor protein class H | P51561 | TETR8_PASMD | Pasteurella multocida | 2 | 0.7708 |
Glucan 1,3-beta-glucosidase | P29717 | EXG1_CANAL | Candida albicans | 3 | 0.7706 |
Glucan 1,3-beta-glucosidase | P29717 | EXG1_CANAL | Candida albicans | 3 | 0.7706 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.7705 |
Histone-lysine N-methyltransferase EHMT1 | Q9H9B1 | EHMT1_HUMAN | Homo sapiens | 3 | 0.7705 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.7705 |
Histone-lysine N-methyltransferase EHMT1 | Q9H9B1 | EHMT1_HUMAN | Homo sapiens | 3 | 0.7705 |
Carminomycin 4-O-methyltransferase DnrK | Q06528 | DNRK_STRPE | Streptomyces peucetius | 3 | 0.7701 |
Carminomycin 4-O-methyltransferase DnrK | Q06528 | DNRK_STRPE | Streptomyces peucetius | 3 | 0.7701 |
Nitric oxide synthase 1 | P29476 | NOS1_RAT | Rattus norvegicus | 3 | 0.7691 |
Nitric oxide synthase 1 | P29476 | NOS1_RAT | Rattus norvegicus | 3 | 0.7691 |
Nickel-binding periplasmic protein | P33590 | NIKA_ECOLI | Escherichia coli | 2 | 0.7672 |
Nickel-binding periplasmic protein | P33590 | NIKA_ECOLI | Escherichia coli | 2 | 0.7672 |
Elongin-B | Q15370 | ELOB_HUMAN | Homo sapiens | 3 | 0.7671 |
Elongin-B | Q15370 | ELOB_HUMAN | Homo sapiens | 3 | 0.7671 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.7662 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.7662 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7640 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7640 |
RNA-dependent RNA polymerase | Q6A562 | Q6A562_9VIRU | Thosea asigna virus | 2 | 0.7617 |
RNA-dependent RNA polymerase | Q6A562 | Q6A562_9VIRU | Thosea asigna virus | 2 | 0.7617 |
Purine nucleoside phosphorylase | P55859 | PNPH_BOVIN | Bos taurus | 2 | 0.7604 |
Purine nucleoside phosphorylase | P55859 | PNPH_BOVIN | Bos taurus | 2 | 0.7604 |
Prostaglandin F2a synthase | Q8I6L9 | Q8I6L9_TRYCR | Trypanosoma cruzi | 2 | 0.7599 |
Prostaglandin F2a synthase | Q8I6L9 | Q8I6L9_TRYCR | Trypanosoma cruzi | 2 | 0.7599 |
Nicotinamide phosphoribosyltransferase | P43490 | NAMPT_HUMAN | Homo sapiens | 3 | 0.7597 |
Nicotinamide phosphoribosyltransferase | P43490 | NAMPT_HUMAN | Homo sapiens | 3 | 0.7597 |
Alpha/beta hydrolase fold protein | D2J2T6 | D2J2T6_9RHIZ | Ochrobactrum sp. T63 | 3 | 0.7587 |
Alpha/beta hydrolase fold protein | D2J2T6 | D2J2T6_9RHIZ | Ochrobactrum sp. T63 | 3 | 0.7587 |
Probable nicotinate-nucleotide adenylyltransferase | C3L5T6 | NADD_BACAC | Bacillus anthracis | 3 | 0.7585 |
Probable nicotinate-nucleotide adenylyltransferase | C3L5T6 | NADD_BACAC | Bacillus anthracis | 3 | 0.7585 |
Bifunctional dihydrofolate reductase-thymidylate synthase | A7UD81 | A7UD81_PLAFA | Plasmodium falciparum | 3 | 0.7582 |
Bifunctional dihydrofolate reductase-thymidylate synthase | A7UD81 | A7UD81_PLAFA | Plasmodium falciparum | 3 | 0.7582 |
11-beta-hydroxysteroid dehydrogenase 1 | P28845 | DHI1_HUMAN | Homo sapiens | 3 | 0.7575 |
11-beta-hydroxysteroid dehydrogenase 1 | P28845 | DHI1_HUMAN | Homo sapiens | 3 | 0.7575 |
Transitional endoplasmic reticulum ATPase | P55072 | TERA_HUMAN | Homo sapiens | 3 | 0.7571 |
Transitional endoplasmic reticulum ATPase | P55072 | TERA_HUMAN | Homo sapiens | 3 | 0.7571 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7567 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7567 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 4 | 0.7563 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 4 | 0.7563 |
Insulin-degrading enzyme | P14735 | IDE_HUMAN | Homo sapiens | 2 | 0.7558 |
Insulin-degrading enzyme | P14735 | IDE_HUMAN | Homo sapiens | 2 | 0.7558 |
ADP-ribosylation factor 1 | P84080 | ARF1_BOVIN | Bos taurus | 2 | 0.7553 |
ADP-ribosylation factor 1 | P84080 | ARF1_BOVIN | Bos taurus | 2 | 0.7553 |
Endoplasmin | P41148 | ENPL_CANLF | Canis lupus familiaris | 3 | 0.7551 |
Endoplasmin | P41148 | ENPL_CANLF | Canis lupus familiaris | 3 | 0.7551 |
Stromelysin-1 | P08254 | MMP3_HUMAN | Homo sapiens | 2 | 0.7541 |
Stromelysin-1 | P08254 | MMP3_HUMAN | Homo sapiens | 2 | 0.7541 |
Elongation factor Tu 1 | P0CE47 | EFTU1_ECOLI | Escherichia coli | 3 | 0.7534 |
Elongation factor Tu 1 | P0CE47 | EFTU1_ECOLI | Escherichia coli | 3 | 0.7534 |
NADPH dehydrogenase 1 | Q02899 | OYE1_SACPS | Saccharomyces pastorianus | 2 | 0.7533 |
NADPH dehydrogenase 1 | Q02899 | OYE1_SACPS | Saccharomyces pastorianus | 2 | 0.7533 |
DNA mismatch repair protein MutS | P23909 | MUTS_ECOLI | Escherichia coli | 3 | 0.7529 |
DNA mismatch repair protein MutS | P23909 | MUTS_ECOLI | Escherichia coli | 3 | 0.7529 |
Adenine DNA glycosylase | P83847 | MUTY_GEOSE | Geobacillus stearothermophilus | 3 | 0.7519 |
Tetracycline repressor protein class D | P0ACT4 | TETR4_ECOLX | Escherichia coli | 2 | 0.7519 |
Stromelysin-1 | P08254 | MMP3_HUMAN | Homo sapiens | 2 | 0.7519 |
Stromelysin-1 | P08254 | MMP3_HUMAN | Homo sapiens | 2 | 0.7519 |
Tetracycline repressor protein class D | P0ACT4 | TETR4_ECOLX | Escherichia coli | 2 | 0.7519 |
Adenine DNA glycosylase | P83847 | MUTY_GEOSE | Geobacillus stearothermophilus | 3 | 0.7519 |
Purine phosphoribosyltransferase (GpT-1) | Q97W95 | Q97W95_SACS2 | Saccharolobus solfataricus | 3 | 0.7517 |
Purine phosphoribosyltransferase (GpT-1) | Q97W95 | Q97W95_SACS2 | Saccharolobus solfataricus | 3 | 0.7517 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.7516 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.7516 |
Nitric oxide synthase 1 | P29476 | NOS1_RAT | Rattus norvegicus | 3 | 0.7510 |
Nitric oxide synthase 1 | P29476 | NOS1_RAT | Rattus norvegicus | 3 | 0.7510 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7501 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7501 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7498 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7498 |
Flavin reductase like domain-containing protein | Q4UKE8 | Q4UKE8_RICFE | Rickettsia felis | 3 | 0.7497 |
Flavin reductase like domain-containing protein | Q4UKE8 | Q4UKE8_RICFE | Rickettsia felis | 3 | 0.7497 |
Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial | Q8N5Z0 | AADAT_HUMAN | Homo sapiens | 2 | 0.7496 |
Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial | Q8N5Z0 | AADAT_HUMAN | Homo sapiens | 2 | 0.7496 |
Thiamine pyrophosphokinase | P35202 | THI80_YEAST | Saccharomyces cerevisiae | 4 | 0.7494 |
Thiamine pyrophosphokinase | P35202 | THI80_YEAST | Saccharomyces cerevisiae | 4 | 0.7494 |
Serine/threonine-protein kinase Chk1 | O14757 | CHK1_HUMAN | Homo sapiens | 3 | 0.7490 |
Serine/threonine-protein kinase Chk1 | O14757 | CHK1_HUMAN | Homo sapiens | 3 | 0.7490 |
Thermolysin | P00800 | THER_BACTH | Bacillus thermoproteolyticus | 3 | 0.7489 |
Thermolysin | P00800 | THER_BACTH | Bacillus thermoproteolyticus | 3 | 0.7489 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7487 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7487 |
Flavoredoxin | Q72HI0 | Q72HI0_THET2 | Thermus thermophilus | 2 | 0.7475 |
Flavoredoxin | Q72HI0 | Q72HI0_THET2 | Thermus thermophilus | 2 | 0.7475 |
Pteridine reductase 1 | Q01782 | PTR1_LEIMA | Leishmania major | 2 | 0.7473 |
Pteridine reductase 1 | Q01782 | PTR1_LEIMA | Leishmania major | 2 | 0.7473 |
Mitogen-activated protein kinase 1 | P63086 | MK01_RAT | Rattus norvegicus | 3 | 0.7472 |
Mitogen-activated protein kinase 1 | P63086 | MK01_RAT | Rattus norvegicus | 3 | 0.7472 |
prolyl oligopeptidase | Q9X6R4 | Q9X6R4_AERCA | Aeromonas caviae | 2 | 0.7468 |
prolyl oligopeptidase | Q9X6R4 | Q9X6R4_AERCA | Aeromonas caviae | 2 | 0.7468 |
S-adenosylmethionine decarboxylase proenzyme | P17707 | DCAM_HUMAN | Homo sapiens | 3 | 0.7465 |
S-adenosylmethionine decarboxylase proenzyme | P17707 | DCAM_HUMAN | Homo sapiens | 3 | 0.7465 |
ATP-dependent molecular chaperone HSP82 | P02829 | HSP82_YEAST | Saccharomyces cerevisiae | 2 | 0.7463 |
ATP-dependent molecular chaperone HSP82 | P02829 | HSP82_YEAST | Saccharomyces cerevisiae | 2 | 0.7463 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 2 | 0.7463 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 2 | 0.7463 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7459 |
Oxygen-insensitive NAD(P)H nitroreductase | P38489 | NFSB_ECOLI | Escherichia coli | 3 | 0.7459 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7459 |
Oxygen-insensitive NAD(P)H nitroreductase | P38489 | NFSB_ECOLI | Escherichia coli | 3 | 0.7459 |
3-oxoacyl-[acyl-carrier-protein] synthase 2 | P0AAI5 | FABF_ECOLI | Escherichia coli | 3 | 0.7449 |
3-oxoacyl-[acyl-carrier-protein] synthase 2 | P0AAI5 | FABF_ECOLI | Escherichia coli | 3 | 0.7449 |
Tetracycline repressor protein class D | P0ACT4 | TETR4_ECOLX | Escherichia coli | 2 | 0.7448 |
Tetracycline repressor protein class D | P0ACT4 | TETR4_ECOLX | Escherichia coli | 2 | 0.7448 |
2-phospho-L-lactate transferase | Q8PVT6 | COFD_METMA | Methanosarcina mazei | 2 | 0.7441 |
Insulin-like growth factor 1 receptor | P08069 | IGF1R_HUMAN | Homo sapiens | 2 | 0.7441 |
2-phospho-L-lactate transferase | Q8PVT6 | COFD_METMA | Methanosarcina mazei | 2 | 0.7441 |
Insulin-like growth factor 1 receptor | P08069 | IGF1R_HUMAN | Homo sapiens | 2 | 0.7441 |
2-phospho-L-lactate transferase | Q8PVT6 | COFD_METMA | Methanosarcina mazei | 2 | 0.7437 |
2-phospho-L-lactate transferase | Q8PVT6 | COFD_METMA | Methanosarcina mazei | 2 | 0.7437 |
DNA mismatch repair protein Msh2 | P43246 | MSH2_HUMAN | Homo sapiens | 3 | 0.7434 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7434 |
DNA mismatch repair protein Msh2 | P43246 | MSH2_HUMAN | Homo sapiens | 3 | 0.7434 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7434 |
Dipeptidyl peptidase 4 | P27487 | DPP4_HUMAN | Homo sapiens | 2 | 0.7434 |
Dipeptidyl peptidase 4 | P27487 | DPP4_HUMAN | Homo sapiens | 2 | 0.7434 |
Dipeptidyl peptidase 4 | P14740 | DPP4_RAT | Rattus norvegicus | 2 | 0.7432 |
Dipeptidyl peptidase 4 | P14740 | DPP4_RAT | Rattus norvegicus | 2 | 0.7432 |
Chromosomal replication initiator protein DnaA | P46798 | DNAA_THEMA | Thermotoga maritima | 3 | 0.7423 |
Chromosomal replication initiator protein DnaA | P46798 | DNAA_THEMA | Thermotoga maritima | 3 | 0.7423 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7417 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7417 |
Putative S-adenosyl-L-methionine-dependent methyltransferase ML2640 | Q9CCZ4 | Y2640_MYCLE | Mycobacterium leprae | 3 | 0.7416 |
Putative S-adenosyl-L-methionine-dependent methyltransferase ML2640 | Q9CCZ4 | Y2640_MYCLE | Mycobacterium leprae | 3 | 0.7416 |
Serine/threonine-protein kinase PLK1 | P53350 | PLK1_HUMAN | Homo sapiens | 3 | 0.7412 |
Alpha-ketoglutarate-dependent dioxygenase FTO | Q9C0B1 | FTO_HUMAN | Homo sapiens | 2 | 0.7412 |
Alpha-ketoglutarate-dependent dioxygenase FTO | Q9C0B1 | FTO_HUMAN | Homo sapiens | 2 | 0.7412 |
Serine/threonine-protein kinase PLK1 | P53350 | PLK1_HUMAN | Homo sapiens | 3 | 0.7412 |
Kinesin-like protein KIF11 | P52732 | KIF11_HUMAN | Homo sapiens | 2 | 0.7408 |
Kinesin-like protein KIF11 | P52732 | KIF11_HUMAN | Homo sapiens | 2 | 0.7408 |
cAMP-dependent protein kinase catalytic subunit alpha | P17612 | KAPCA_HUMAN | Homo sapiens | 3 | 0.7406 |
cAMP-dependent protein kinase catalytic subunit alpha | P17612 | KAPCA_HUMAN | Homo sapiens | 3 | 0.7406 |
Beta-galactosidase | P00722 | BGAL_ECOLI | Escherichia coli | 2 | 0.7399 |
Beta-galactosidase | P00722 | BGAL_ECOLI | Escherichia coli | 2 | 0.7399 |
Thymidylate kinase | Q8I4S1 | Q8I4S1_PLAF7 | Plasmodium falciparum | 4 | 0.7391 |
Thymidylate kinase | Q8I4S1 | Q8I4S1_PLAF7 | Plasmodium falciparum | 4 | 0.7391 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7390 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7390 |
3-phosphoinositide-dependent protein kinase 1 | O15530 | PDPK1_HUMAN | Homo sapiens | 3 | 0.7378 |
3-phosphoinositide-dependent protein kinase 1 | O15530 | PDPK1_HUMAN | Homo sapiens | 3 | 0.7378 |
Serine/threonine-protein kinase PLK1 | P53350 | PLK1_HUMAN | Homo sapiens | 4 | 0.7377 |
Serine/threonine-protein kinase PLK1 | P53350 | PLK1_HUMAN | Homo sapiens | 4 | 0.7377 |
Phosphotriesterase | Q5KZU5 | Q5KZU5_GEOKA | Geobacillus kaustophilus | 2 | 0.7376 |
Phosphotriesterase | Q5KZU5 | Q5KZU5_GEOKA | Geobacillus kaustophilus | 2 | 0.7376 |
Cathepsin S | P25774 | CATS_HUMAN | Homo sapiens | 2 | 0.7372 |
Cathepsin S | P25774 | CATS_HUMAN | Homo sapiens | 2 | 0.7372 |
Phenylpyruvate C(3)-methyltransferase | Q643C8 | MPPJ_STRHY | Streptomyces hygroscopicus | 2 | 0.7371 |
Phenylpyruvate C(3)-methyltransferase | Q643C8 | MPPJ_STRHY | Streptomyces hygroscopicus | 2 | 0.7371 |
Type II methyltransferase M.TaqI | P14385 | MTTA_THEAQ | Thermus aquaticus | 3 | 0.7370 |
Type II methyltransferase M.TaqI | P14385 | MTTA_THEAQ | Thermus aquaticus | 3 | 0.7370 |
Dihydrofolate reductase | P00378 | DYR_CHICK | Gallus gallus | 2 | 0.7370 |
Dihydrofolate reductase | P00378 | DYR_CHICK | Gallus gallus | 2 | 0.7370 |
ATP-dependent molecular chaperone HSP82 | P02829 | HSP82_YEAST | Saccharomyces cerevisiae | 2 | 0.7368 |
ATP-dependent molecular chaperone HSP82 | P02829 | HSP82_YEAST | Saccharomyces cerevisiae | 2 | 0.7368 |
Proline iminopeptidase | O32449 | PIP_SERMA | Serratia marcescens | 3 | 0.7366 |
Proline iminopeptidase | O32449 | PIP_SERMA | Serratia marcescens | 3 | 0.7366 |
Toluene-4-monooxygenase system, hydroxylase component subunit alpha | Q00456 | TMOA_PSEME | Pseudomonas mendocina | 2 | 0.7361 |
Toluene-4-monooxygenase system, hydroxylase component subunit alpha | Q00456 | TMOA_PSEME | Pseudomonas mendocina | 2 | 0.7361 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7360 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7360 |
Beta-secretase 1 | P56817 | BACE1_HUMAN | Homo sapiens | 2 | 0.7355 |
Beta-secretase 1 | P56817 | BACE1_HUMAN | Homo sapiens | 2 | 0.7355 |
Vanillyl-alcohol oxidase | P56216 | VAOX_PENSI | Penicillium simplicissimum | 3 | 0.7354 |
Vanillyl-alcohol oxidase | P56216 | VAOX_PENSI | Penicillium simplicissimum | 3 | 0.7354 |
Renin | P00797 | RENI_HUMAN | Homo sapiens | 2 | 0.7353 |
Renin | P00797 | RENI_HUMAN | Homo sapiens | 2 | 0.7353 |
Nickel-binding periplasmic protein | P33590 | NIKA_ECOLI | Escherichia coli | 2 | 0.7353 |
Nickel-binding periplasmic protein | P33590 | NIKA_ECOLI | Escherichia coli | 2 | 0.7353 |
Aspartokinase 1, chloroplastic | Q9LYU8 | AK1_ARATH | Arabidopsis thaliana | 3 | 0.7352 |
Aspartokinase 1, chloroplastic | Q9LYU8 | AK1_ARATH | Arabidopsis thaliana | 3 | 0.7352 |
Renin | P00797 | RENI_HUMAN | Homo sapiens | 4 | 0.7348 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7348 |
Renin | P00797 | RENI_HUMAN | Homo sapiens | 4 | 0.7348 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7348 |
Aldo-keto reductase family 1 member B1 | P15121 | ALDR_HUMAN | Homo sapiens | 2 | 0.7343 |
Aldo-keto reductase family 1 member B1 | P15121 | ALDR_HUMAN | Homo sapiens | 2 | 0.7343 |
Stromelysin-1 | P08254 | MMP3_HUMAN | Homo sapiens | 2 | 0.7340 |
Stromelysin-1 | P08254 | MMP3_HUMAN | Homo sapiens | 2 | 0.7340 |
3-oxoacyl-[acyl-carrier-protein] synthase 1 | Q2YQQ9 | Q2YQQ9_BRUA2 | Brucella abortus | 3 | 0.7338 |
Genome polyprotein | A0EKU1 | A0EKU1_9FLAV | Meaban virus | 3 | 0.7338 |
3-oxoacyl-[acyl-carrier-protein] synthase 1 | Q2YQQ9 | Q2YQQ9_BRUA2 | Brucella abortus | 3 | 0.7338 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 2 | 0.7338 |
Genome polyprotein | A0EKU1 | A0EKU1_9FLAV | Meaban virus | 3 | 0.7338 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 2 | 0.7338 |
Lethal factor | P15917 | LEF_BACAN | Bacillus anthracis | 2 | 0.7333 |
Lethal factor | P15917 | LEF_BACAN | Bacillus anthracis | 2 | 0.7333 |
5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 | O50008 | METE1_ARATH | Arabidopsis thaliana | 2 | 0.7332 |
5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 | O50008 | METE1_ARATH | Arabidopsis thaliana | 2 | 0.7332 |
Glycoside Hydrolase Family 13 | Q65MI2 | Q65MI2_BACLD | Bacillus licheniformis | 2 | 0.7331 |
Glycoside Hydrolase Family 13 | Q65MI2 | Q65MI2_BACLD | Bacillus licheniformis | 2 | 0.7331 |
SKP1-like protein 1A | Q39255 | SKP1A_ARATH | Arabidopsis thaliana | 3 | 0.7330 |
SKP1-like protein 1A | Q39255 | SKP1A_ARATH | Arabidopsis thaliana | 3 | 0.7330 |
Mitomycin-binding protein | O05205 | O05205_STRLA | Streptomyces lavendulae | 2 | 0.7329 |
Mitomycin-binding protein | O05205 | O05205_STRLA | Streptomyces lavendulae | 2 | 0.7329 |
Succinyl-CoA:acetate CoA-transferase | B3EY95 | SCACT_ACEAC | Acetobacter aceti | 2 | 0.7325 |
Norsolorinic acid synthase | Q12053 | AFLC_ASPPU | Aspergillus parasiticus | 2 | 0.7325 |
Succinyl-CoA:acetate CoA-transferase | B3EY95 | SCACT_ACEAC | Acetobacter aceti | 2 | 0.7325 |
Norsolorinic acid synthase | Q12053 | AFLC_ASPPU | Aspergillus parasiticus | 2 | 0.7325 |
Proto-oncogene tyrosine-protein kinase receptor Ret | P07949 | RET_HUMAN | Homo sapiens | 3 | 0.7321 |
Biflaviolin synthase CYP158A1 | Q9KZF5 | C1581_STRCO | Streptomyces coelicolor / M145) | 2 | 0.7321 |
Biflaviolin synthase CYP158A1 | Q9KZF5 | C1581_STRCO | Streptomyces coelicolor / M145) | 2 | 0.7321 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7321 |
Proto-oncogene tyrosine-protein kinase receptor Ret | P07949 | RET_HUMAN | Homo sapiens | 3 | 0.7321 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7321 |
Heat shock protein HSP 90-alpha | P07900 | HS90A_HUMAN | Homo sapiens | 2 | 0.7318 |
Heat shock protein HSP 90-alpha | P07900 | HS90A_HUMAN | Homo sapiens | 2 | 0.7318 |
Death-associated protein kinase 1 | P53355 | DAPK1_HUMAN | Homo sapiens | 3 | 0.7317 |
Death-associated protein kinase 1 | P53355 | DAPK1_HUMAN | Homo sapiens | 3 | 0.7317 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7314 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7314 |
Tryptophan synthase alpha chain | P00929 | TRPA_SALTY | Salmonella typhimurium | 2 | 0.7312 |
Tryptophan synthase alpha chain | P00929 | TRPA_SALTY | Salmonella typhimurium | 2 | 0.7312 |
Biflaviolin synthase CYP158A2 | Q9FCA6 | C1582_STRCO | Streptomyces coelicolor / M145) | 2 | 0.7310 |
Type II methyltransferase M.TaqI | P14385 | MTTA_THEAQ | Thermus aquaticus | 3 | 0.7310 |
Biflaviolin synthase CYP158A2 | Q9FCA6 | C1582_STRCO | Streptomyces coelicolor / M145) | 2 | 0.7310 |
Type II methyltransferase M.TaqI | P14385 | MTTA_THEAQ | Thermus aquaticus | 3 | 0.7310 |
Polyamine aminopropyltransferase | Q5SK28 | SPEE_THET8 | Thermus thermophilus | 3 | 0.7306 |
Polyamine aminopropyltransferase | Q5SK28 | SPEE_THET8 | Thermus thermophilus | 3 | 0.7306 |
APH(2'')-Id | O68183 | O68183_ENTCA | Enterococcus casseliflavus | 3 | 0.7304 |
Cyclin-dependent kinase 9 | P50750 | CDK9_HUMAN | Homo sapiens | 3 | 0.7304 |
Cyclin-dependent kinase 9 | P50750 | CDK9_HUMAN | Homo sapiens | 3 | 0.7304 |
APH(2'')-Id | O68183 | O68183_ENTCA | Enterococcus casseliflavus | 3 | 0.7304 |
Tyrosine-protein kinase SYK | P43405 | KSYK_HUMAN | Homo sapiens | 3 | 0.7303 |
Tyrosine-protein kinase SYK | P43405 | KSYK_HUMAN | Homo sapiens | 3 | 0.7303 |
NAD-capped RNA hydrolase NudC | P32664 | NUDC_ECOLI | Escherichia coli | 2 | 0.7301 |
NAD-capped RNA hydrolase NudC | P32664 | NUDC_ECOLI | Escherichia coli | 2 | 0.7301 |
Plasmid partition protein A | P07620 | PARA_ECOLX | Escherichia coli | 3 | 0.7299 |
Plasmid partition protein A | P07620 | PARA_ECOLX | Escherichia coli | 3 | 0.7299 |
Focal adhesion kinase 1 | Q05397 | FAK1_HUMAN | Homo sapiens | 2 | 0.7289 |
Focal adhesion kinase 1 | Q05397 | FAK1_HUMAN | Homo sapiens | 2 | 0.7289 |
uroporphyrinogen-III C-methyltransferase | P95417 | P95417_PSEAI | Pseudomonas aeruginosa | 3 | 0.7288 |
uroporphyrinogen-III C-methyltransferase | P95417 | P95417_PSEAI | Pseudomonas aeruginosa | 3 | 0.7288 |
L-lactate dehydrogenase A chain | P13491 | LDHA_RABIT | Oryctolagus cuniculus | 2 | 0.7287 |
L-lactate dehydrogenase A chain | P13491 | LDHA_RABIT | Oryctolagus cuniculus | 2 | 0.7287 |
DNA mismatch repair protein MutS | P23909 | MUTS_ECOLI | Escherichia coli | 3 | 0.7285 |
DNA mismatch repair protein MutS | P23909 | MUTS_ECOLI | Escherichia coli | 3 | 0.7285 |
Sodium-dependent dopamine transporter | Q7K4Y6 | DAT_DROME | Drosophila melanogaster | 2 | 0.7278 |
Sodium-dependent dopamine transporter | Q7K4Y6 | DAT_DROME | Drosophila melanogaster | 2 | 0.7278 |
Gag-Pol polyprotein | P04587 | POL_HV1B5 | Human immunodeficiency virus type 1 group M subtype B | 3 | 0.7277 |
Gag-Pol polyprotein | P04587 | POL_HV1B5 | Human immunodeficiency virus type 1 group M subtype B | 3 | 0.7277 |
Biflaviolin synthase CYP158A2 | Q9FCA6 | C1582_STRCO | Streptomyces coelicolor / M145) | 2 | 0.7276 |
Biflaviolin synthase CYP158A2 | Q9FCA6 | C1582_STRCO | Streptomyces coelicolor / M145) | 2 | 0.7276 |
ATP-dependent Clp protease ATP-binding subunit ClpX | O25926 | CLPX_HELPY | Helicobacter pylori | 3 | 0.7276 |
Genome polyprotein | P12823 | POLG_DEN2P | Dengue virus type 2 | 3 | 0.7276 |
Casein kinase II subunit alpha | P68400 | CSK21_HUMAN | Homo sapiens | 3 | 0.7276 |
Serine/threonine-protein kinase PLK | Q4KMI8 | Q4KMI8_DANRE | Danio rerio | 3 | 0.7276 |
Serine/threonine-protein kinase PLK | Q4KMI8 | Q4KMI8_DANRE | Danio rerio | 3 | 0.7276 |
Casein kinase II subunit alpha | P68400 | CSK21_HUMAN | Homo sapiens | 3 | 0.7276 |
Genome polyprotein | P12823 | POLG_DEN2P | Dengue virus type 2 | 3 | 0.7276 |
ATP-dependent Clp protease ATP-binding subunit ClpX | O25926 | CLPX_HELPY | Helicobacter pylori | 3 | 0.7276 |
Pyridoxal kinase | O00764 | PDXK_HUMAN | Homo sapiens | 2 | 0.7275 |
Pyridoxal kinase | O00764 | PDXK_HUMAN | Homo sapiens | 2 | 0.7275 |
Class B acid phosphatase | P0AE22 | APHA_ECOLI | Escherichia coli | 2 | 0.7273 |
Class B acid phosphatase | P0AE22 | APHA_ECOLI | Escherichia coli | 2 | 0.7273 |
Mismatch repair endonuclease PMS2 | P54278 | PMS2_HUMAN | Homo sapiens | 3 | 0.7268 |
Mismatch repair endonuclease PMS2 | P54278 | PMS2_HUMAN | Homo sapiens | 3 | 0.7268 |
Methyltransferase | D0VX01 | D0VX01_WSLV | Wesselsbron virus | 3 | 0.7265 |
Methyltransferase | D0VX01 | D0VX01_WSLV | Wesselsbron virus | 3 | 0.7265 |
Protease | O09893 | O09893_9HIV1 | Human immunodeficiency virus 1 | 3 | 0.7263 |
Protease | O09893 | O09893_9HIV1 | Human immunodeficiency virus 1 | 3 | 0.7263 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7257 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7257 |
Queuine tRNA-ribosyltransferase | P28720 | TGT_ZYMMO | Zymomonas mobilis subsp. mobilis | 3 | 0.7257 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7257 |
Neocarzinostatin | P0A3R9 | NCZS_STRCZ | Streptomyces carzinostaticus | 2 | 0.7257 |
Neocarzinostatin | P0A3R9 | NCZS_STRCZ | Streptomyces carzinostaticus | 2 | 0.7257 |
Inosine-5'-monophosphate dehydrogenase | P50097 | IMDH_TRIFO | Tritrichomonas foetus | 2 | 0.7256 |
Inosine-5'-monophosphate dehydrogenase | P50097 | IMDH_TRIFO | Tritrichomonas foetus | 2 | 0.7256 |
Ribosomal RNA large subunit methyltransferase H | P0C1V0 | RLMH_STAAU | Staphylococcus aureus | 3 | 0.7253 |
Genome polyprotein | P29991 | POLG_DEN27 | Dengue virus type 2 | 3 | 0.7253 |
Ribosomal RNA large subunit methyltransferase H | P0C1V0 | RLMH_STAAU | Staphylococcus aureus | 3 | 0.7253 |
Genome polyprotein | P29991 | POLG_DEN27 | Dengue virus type 2 | 3 | 0.7253 |
Proline iminopeptidase | O32449 | PIP_SERMA | Serratia marcescens | 3 | 0.7252 |
Proline iminopeptidase | O32449 | PIP_SERMA | Serratia marcescens | 3 | 0.7252 |
Proto-oncogene tyrosine-protein kinase receptor Ret | P07949 | RET_HUMAN | Homo sapiens | 3 | 0.7251 |
Proto-oncogene tyrosine-protein kinase receptor Ret | P07949 | RET_HUMAN | Homo sapiens | 3 | 0.7251 |
VioE domain-containing protein | Q7NSZ5 | Q7NSZ5_CHRVO | Chromobacterium violaceum | 2 | 0.7248 |
VioE domain-containing protein | Q7NSZ5 | Q7NSZ5_CHRVO | Chromobacterium violaceum | 2 | 0.7248 |
Tryptophan synthase alpha chain | P00929 | TRPA_SALTY | Salmonella typhimurium | 2 | 0.7247 |
Tryptophan synthase alpha chain | P00929 | TRPA_SALTY | Salmonella typhimurium | 2 | 0.7247 |
Myosin heavy chain kinase A | P42527 | MHCKA_DICDI | Dictyostelium discoideum | 3 | 0.7246 |
Myosin heavy chain kinase A | P42527 | MHCKA_DICDI | Dictyostelium discoideum | 3 | 0.7246 |
Vascular endothelial growth factor receptor 2 | P35968 | VGFR2_HUMAN | Homo sapiens | 3 | 0.7245 |
Vascular endothelial growth factor receptor 2 | P35968 | VGFR2_HUMAN | Homo sapiens | 3 | 0.7245 |
Mandelate racemase | P11444 | MANR_PSEPU | Pseudomonas putida | 2 | 0.7244 |
Mandelate racemase | P11444 | MANR_PSEPU | Pseudomonas putida | 2 | 0.7244 |
Mitogen-activated protein kinase 1 | P28482 | MK01_HUMAN | Homo sapiens | 2 | 0.7243 |
Mitogen-activated protein kinase 1 | P28482 | MK01_HUMAN | Homo sapiens | 2 | 0.7243 |
3-oxoacyl-[acyl-carrier-protein] synthase 2 | P0AAI5 | FABF_ECOLI | Escherichia coli | 4 | 0.7240 |
3-oxoacyl-[acyl-carrier-protein] synthase 2 | P0AAI5 | FABF_ECOLI | Escherichia coli | 4 | 0.7240 |
L-lactate dehydrogenase (cytochrome) | P00175 | CYB2_YEAST | Saccharomyces cerevisiae | 2 | 0.7231 |
L-lactate dehydrogenase (cytochrome) | P00175 | CYB2_YEAST | Saccharomyces cerevisiae | 2 | 0.7231 |
5'-methylthioadenosine nucleosidase / s-adenosylhomocysteine nucleosidase | Q8YBL1 | Q8YBL1_BRUME | Brucella melitensis biotype 1 | 3 | 0.7230 |
Cyclin-dependent kinase 9 | P50750 | CDK9_HUMAN | Homo sapiens | 3 | 0.7230 |
5'-methylthioadenosine nucleosidase / s-adenosylhomocysteine nucleosidase | Q8YBL1 | Q8YBL1_BRUME | Brucella melitensis biotype 1 | 3 | 0.7230 |
Cyclin-dependent kinase 9 | P50750 | CDK9_HUMAN | Homo sapiens | 3 | 0.7230 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7228 |
eIF-2-alpha kinase GCN2 | P15442 | GCN2_YEAST | Saccharomyces cerevisiae | 3 | 0.7228 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7228 |
eIF-2-alpha kinase GCN2 | P15442 | GCN2_YEAST | Saccharomyces cerevisiae | 3 | 0.7228 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7224 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7224 |
Serine/threonine-protein kinase 24 | Q9Y6E0 | STK24_HUMAN | Homo sapiens | 3 | 0.7218 |
Serine/threonine-protein kinase 24 | Q9Y6E0 | STK24_HUMAN | Homo sapiens | 3 | 0.7218 |
Peripheral plasma membrane protein CASK | O14936 | CSKP_HUMAN | Homo sapiens | 3 | 0.7217 |
Peripheral plasma membrane protein CASK | O14936 | CSKP_HUMAN | Homo sapiens | 3 | 0.7217 |
Chaperone protein ClpB | Q9RA63 | CLPB_THET8 | Thermus thermophilus | 3 | 0.7216 |
Chaperone protein ClpB | Q9RA63 | CLPB_THET8 | Thermus thermophilus | 3 | 0.7216 |
Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase | Q9TQS6 | DHDH_MACFA | Macaca fascicularis | 2 | 0.7215 |
Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase | Q9TQS6 | DHDH_MACFA | Macaca fascicularis | 2 | 0.7215 |
Signaling protein | P83820 | P83820_THETH | Thermus thermophilus | 3 | 0.7214 |
Signaling protein | P83820 | P83820_THETH | Thermus thermophilus | 3 | 0.7214 |
Tyrosine-protein kinase ABL1 | P00519 | ABL1_HUMAN | Homo sapiens | 3 | 0.7210 |
Tyrosine-protein kinase ABL1 | P00519 | ABL1_HUMAN | Homo sapiens | 3 | 0.7210 |
5-formaminoimidazole-4-carboxamide-1-(beta)-D-ribofuranosyl 5'-monophosphate synthetase | Q8U0R7 | PURP_PYRFU | Pyrococcus furiosus | 3 | 0.7208 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7208 |
5-formaminoimidazole-4-carboxamide-1-(beta)-D-ribofuranosyl 5'-monophosphate synthetase | Q8U0R7 | PURP_PYRFU | Pyrococcus furiosus | 3 | 0.7208 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7208 |
D-alanyl-D-alanine carboxypeptidase | P15555 | DAC_STRSR | Streptomyces sp | 2 | 0.7205 |
D-alanyl-D-alanine carboxypeptidase | P15555 | DAC_STRSR | Streptomyces sp | 2 | 0.7205 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7203 |
Biotin carboxylase | P24182 | ACCC_ECOLI | Escherichia coli | 3 | 0.7203 |
Rho-associated protein kinase 1 | Q13464 | ROCK1_HUMAN | Homo sapiens | 3 | 0.7203 |
Biotin carboxylase | P24182 | ACCC_ECOLI | Escherichia coli | 3 | 0.7203 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7203 |
Rho-associated protein kinase 1 | Q13464 | ROCK1_HUMAN | Homo sapiens | 3 | 0.7203 |
Hygromycin-B 4-O-kinase | P00557 | KHYB_ECOLX | Escherichia coli | 3 | 0.7202 |
Hygromycin-B 4-O-kinase | P00557 | KHYB_ECOLX | Escherichia coli | 3 | 0.7202 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7200 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7200 |
Maltokinase | A1TH50 | MAK_MYCVP | Mycolicibacterium vanbaalenii | 3 | 0.7198 |
Maltokinase | A1TH50 | MAK_MYCVP | Mycolicibacterium vanbaalenii | 3 | 0.7198 |
cGMP-dependent 3',5'-cyclic phosphodiesterase | O00408 | PDE2A_HUMAN | Homo sapiens | 3 | 0.7198 |
cGMP-dependent 3',5'-cyclic phosphodiesterase | O00408 | PDE2A_HUMAN | Homo sapiens | 3 | 0.7198 |
Gag-Pol polyprotein | P04587 | POL_HV1B5 | Human immunodeficiency virus type 1 group M subtype B | 4 | 0.7197 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.7197 |
Gag-Pol polyprotein | P04587 | POL_HV1B5 | Human immunodeficiency virus type 1 group M subtype B | 4 | 0.7197 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.7197 |
Beta-galactoside alpha-2,6-sialyltransferase 1 | P15907 | SIAT1_HUMAN | Homo sapiens | 3 | 0.7195 |
Beta-galactoside alpha-2,6-sialyltransferase 1 | P15907 | SIAT1_HUMAN | Homo sapiens | 3 | 0.7195 |
M17 leucyl aminopeptidase | Q8IL11 | Q8IL11_PLAF7 | Plasmodium falciparum | 3 | 0.7194 |
M17 leucyl aminopeptidase | Q8IL11 | Q8IL11_PLAF7 | Plasmodium falciparum | 3 | 0.7194 |
Serine/threonine-protein kinase Chk1 | O14757 | CHK1_HUMAN | Homo sapiens | 3 | 0.7194 |
Serine/threonine-protein kinase Chk1 | O14757 | CHK1_HUMAN | Homo sapiens | 3 | 0.7194 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.7192 |
Sex hormone-binding globulin | P04278 | SHBG_HUMAN | Homo sapiens | 2 | 0.7192 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.7192 |
Sex hormone-binding globulin | P04278 | SHBG_HUMAN | Homo sapiens | 2 | 0.7192 |
Mitogen-activated protein kinase kinase kinase 7 | O43318 | M3K7_HUMAN | Homo sapiens | 3 | 0.7191 |
Mitogen-activated protein kinase kinase kinase 7 | O43318 | M3K7_HUMAN | Homo sapiens | 3 | 0.7191 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 4 | 0.7190 |
Muconolactone Delta-isomerase | Q8G9L0 | Q8G9L0_RHOOP | Rhodococcus opacus | 2 | 0.7190 |
Muconolactone Delta-isomerase | Q8G9L0 | Q8G9L0_RHOOP | Rhodococcus opacus | 2 | 0.7190 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 4 | 0.7190 |
Carbonic anhydrase 1 | P00915 | CAH1_HUMAN | Homo sapiens | 2 | 0.7190 |
Carbonic anhydrase 1 | P00915 | CAH1_HUMAN | Homo sapiens | 2 | 0.7190 |
Pteridine reductase 1 | Q01782 | PTR1_LEIMA | Leishmania major | 2 | 0.7189 |
Pteridine reductase 1 | Q01782 | PTR1_LEIMA | Leishmania major | 2 | 0.7189 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7184 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7184 |
Proton-gated ion channel | Q7NDN8 | GLIC_GLOVI | Gloeobacter violaceus | 2 | 0.7183 |
Proton-gated ion channel | Q7NDN8 | GLIC_GLOVI | Gloeobacter violaceus | 2 | 0.7183 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7182 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7182 |
Cytochrome b-c1 complex subunit 1, mitochondrial | P31800 | QCR1_BOVIN | Bos taurus | 3 | 0.7181 |
Cytochrome b-c1 complex subunit 1, mitochondrial | P31800 | QCR1_BOVIN | Bos taurus | 3 | 0.7181 |
ATP-dependent protease ATPase subunit HslU | P43773 | HSLU_HAEIN | Haemophilus influenzae | 3 | 0.7177 |
ATP-dependent protease ATPase subunit HslU | P43773 | HSLU_HAEIN | Haemophilus influenzae | 3 | 0.7177 |
APH(2'')-Id | O68183 | O68183_ENTCA | Enterococcus casseliflavus | 3 | 0.7176 |
Biotin carboxylase | P43873 | ACCC_HAEIN | Haemophilus influenzae | 3 | 0.7176 |
APH(2'')-Id | O68183 | O68183_ENTCA | Enterococcus casseliflavus | 3 | 0.7176 |
Biotin carboxylase | P43873 | ACCC_HAEIN | Haemophilus influenzae | 3 | 0.7176 |
(R)-S-adenosyl-L-methionine hydrolase | O58212 | O58212_PYRHO | Pyrococcus horikoshii OT3 | 3 | 0.7174 |
(R)-S-adenosyl-L-methionine hydrolase | O58212 | O58212_PYRHO | Pyrococcus horikoshii OT3 | 3 | 0.7174 |
Eukaryotic translation initiation factor 4E type 3 | Q9DBB5 | IF4E3_MOUSE | Mus musculus | 3 | 0.7174 |
Eukaryotic translation initiation factor 4E type 3 | Q9DBB5 | IF4E3_MOUSE | Mus musculus | 3 | 0.7174 |
Myosin heavy chain kinase A | P42527 | MHCKA_DICDI | Dictyostelium discoideum | 3 | 0.7170 |
Phosphatidylinositol 5-phosphate 4-kinase type-2 beta | P78356 | PI42B_HUMAN | Homo sapiens | 3 | 0.7170 |
Phosphatidylinositol 5-phosphate 4-kinase type-2 beta | P78356 | PI42B_HUMAN | Homo sapiens | 3 | 0.7170 |
Myosin heavy chain kinase A | P42527 | MHCKA_DICDI | Dictyostelium discoideum | 3 | 0.7170 |
3-alpha-(or 20-beta)-hydroxysteroid dehydrogenase | P19992 | HSD_STREX | Streptomyces exfoliatus | 2 | 0.7168 |
SRSF protein kinase 1 | Q96SB4 | SRPK1_HUMAN | Homo sapiens | 3 | 0.7168 |
SRSF protein kinase 1 | Q96SB4 | SRPK1_HUMAN | Homo sapiens | 3 | 0.7168 |
3-alpha-(or 20-beta)-hydroxysteroid dehydrogenase | P19992 | HSD_STREX | Streptomyces exfoliatus | 2 | 0.7168 |
7,8-dihydroneopterin aldolase | J7VEZ6 | J7VEZ6_BACCE | Bacillus cereus BAG3X2-1 | 2 | 0.7168 |
7,8-dihydroneopterin aldolase | J7VEZ6 | J7VEZ6_BACCE | Bacillus cereus BAG3X2-1 | 2 | 0.7168 |
L-lactate dehydrogenase A chain | P04642 | LDHA_RAT | Rattus norvegicus | 3 | 0.7166 |
L-lactate dehydrogenase A chain | P04642 | LDHA_RAT | Rattus norvegicus | 3 | 0.7166 |
Ribosomal protein S6 kinase beta-1 | P23443 | KS6B1_HUMAN | Homo sapiens | 3 | 0.7165 |
Ribosomal protein S6 kinase beta-1 | P23443 | KS6B1_HUMAN | Homo sapiens | 3 | 0.7165 |
4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | O67060 | ISPE_AQUAE | Aquifex aeolicus | 3 | 0.7160 |
4-diphosphocytidyl-2-C-methyl-D-erythritol kinase | O67060 | ISPE_AQUAE | Aquifex aeolicus | 3 | 0.7160 |
Epidermal growth factor receptor | P00533 | EGFR_HUMAN | Homo sapiens | 3 | 0.7158 |
Epidermal growth factor receptor | P00533 | EGFR_HUMAN | Homo sapiens | 3 | 0.7158 |
Purine nucleoside phosphorylase DeoD-type | P0ABP9 | DEOD_ECO57 | Escherichia coli O157:H7 | 2 | 0.7156 |
Purine nucleoside phosphorylase DeoD-type | P0ABP9 | DEOD_ECO57 | Escherichia coli O157:H7 | 2 | 0.7156 |
Cyclin-dependent kinase 9 | P50750 | CDK9_HUMAN | Homo sapiens | 3 | 0.7156 |
Cyclin-dependent kinase 9 | P50750 | CDK9_HUMAN | Homo sapiens | 3 | 0.7156 |
Carbonic anhydrase | Q39588 | Q39588_CHLRE | Chlamydomonas reinhardtii | 2 | 0.7154 |
Carbonic anhydrase | Q39588 | Q39588_CHLRE | Chlamydomonas reinhardtii | 2 | 0.7154 |
Bifunctional epoxide hydrolase 2 | P34913 | HYES_HUMAN | Homo sapiens | 2 | 0.7153 |
Bifunctional epoxide hydrolase 2 | P34913 | HYES_HUMAN | Homo sapiens | 2 | 0.7153 |
Purine nucleoside phosphorylase DeoD-type | B1JL34 | DEOD_YERPY | Yersinia pseudotuberculosis serotype O:3 | 2 | 0.7152 |
Purine nucleoside phosphorylase DeoD-type | B1JL34 | DEOD_YERPY | Yersinia pseudotuberculosis serotype O:3 | 2 | 0.7152 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7149 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7149 |
Protein mono-ADP-ribosyltransferase PARP14 | Q460N5 | PAR14_HUMAN | Homo sapiens | 2 | 0.7147 |
Protein mono-ADP-ribosyltransferase PARP14 | Q460N5 | PAR14_HUMAN | Homo sapiens | 2 | 0.7147 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7144 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7144 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7143 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7143 |
Serine/threonine-protein kinase CtkA | Q9ZKJ5 | CTKA_HELPJ | Helicobacter pylori | 3 | 0.7141 |
Serine/threonine-protein kinase CtkA | Q9ZKJ5 | CTKA_HELPJ | Helicobacter pylori | 3 | 0.7141 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7137 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7137 |
Rhodopsin kinase GRK1 | P28327 | GRK1_BOVIN | Bos taurus | 3 | 0.7135 |
Rhodopsin kinase GRK1 | P28327 | GRK1_BOVIN | Bos taurus | 3 | 0.7135 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7135 |
tRNA (adenine(9)-N1)-methyltransferase | Q4J894 | TRM10_SULAC | Sulfolobus acidocaldarius | 3 | 0.7135 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 2 | 0.7135 |
tRNA (adenine(9)-N1)-methyltransferase | Q4J894 | TRM10_SULAC | Sulfolobus acidocaldarius | 3 | 0.7135 |
Eukaryotic translation initiation factor 2 subunit alpha | P20459 | IF2A_YEAST | Saccharomyces cerevisiae | 3 | 0.7133 |
Eukaryotic translation initiation factor 2 subunit alpha | P20459 | IF2A_YEAST | Saccharomyces cerevisiae | 3 | 0.7133 |
Bifunctional 3'-phosphoadenosine 5'-phosphosulfate synthase 2 | O95340 | PAPS2_HUMAN | Homo sapiens | 2 | 0.7132 |
Bifunctional 3'-phosphoadenosine 5'-phosphosulfate synthase 2 | O95340 | PAPS2_HUMAN | Homo sapiens | 2 | 0.7132 |
Rhodopsin kinase GRK1 | P28327 | GRK1_BOVIN | Bos taurus | 3 | 0.7131 |
Rhodopsin kinase GRK1 | P28327 | GRK1_BOVIN | Bos taurus | 3 | 0.7131 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7127 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7127 |
Protein mono-ADP-ribosyltransferase PARP3 | Q9Y6F1 | PARP3_HUMAN | Homo sapiens | 3 | 0.7126 |
Protein mono-ADP-ribosyltransferase PARP3 | Q9Y6F1 | PARP3_HUMAN | Homo sapiens | 3 | 0.7126 |
Carbonic anhydrase 2 | P00918 | CAH2_HUMAN | Homo sapiens | 2 | 0.7126 |
Carbonic anhydrase 2 | P00918 | CAH2_HUMAN | Homo sapiens | 2 | 0.7126 |
Death-associated protein kinase 1 | P53355 | DAPK1_HUMAN | Homo sapiens | 3 | 0.7123 |
Death-associated protein kinase 1 | P53355 | DAPK1_HUMAN | Homo sapiens | 3 | 0.7123 |
Hygromycin-B 4-O-kinase | P00557 | KHYB_ECOLX | Escherichia coli | 3 | 0.7122 |
Hygromycin-B 4-O-kinase | P00557 | KHYB_ECOLX | Escherichia coli | 3 | 0.7122 |
SKP1-like protein 1A | Q39255 | SKP1A_ARATH | Arabidopsis thaliana | 2 | 0.7121 |
Serine/threonine-protein kinase RIO1 | Q9BRS2 | RIOK1_HUMAN | Homo sapiens | 3 | 0.7121 |
SKP1-like protein 1A | Q39255 | SKP1A_ARATH | Arabidopsis thaliana | 2 | 0.7121 |
Serine/threonine-protein kinase RIO1 | Q9BRS2 | RIOK1_HUMAN | Homo sapiens | 3 | 0.7121 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7114 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7114 |
Geranyl diphosphate 2-C-methyltransferase | D3KYU3 | GPPMT_STRLS | Streptomyces lasalocidi | 3 | 0.7112 |
Geranyl diphosphate 2-C-methyltransferase | D3KYU3 | GPPMT_STRLS | Streptomyces lasalocidi | 3 | 0.7112 |
Tetracycline repressor protein class D | P0ACT4 | TETR4_ECOLX | Escherichia coli | 2 | 0.7111 |
Cytosine-specific methyltransferase | Q8EVR5 | Q8EVR5_MYCPE | Mycoplasma penetrans | 3 | 0.7111 |
D-aminoacyl-tRNA deacylase | Q8IIS0 | DTD_PLAF7 | Plasmodium falciparum | 2 | 0.7111 |
D-aminoacyl-tRNA deacylase | Q8IIS0 | DTD_PLAF7 | Plasmodium falciparum | 2 | 0.7111 |
Cytosine-specific methyltransferase | Q8EVR5 | Q8EVR5_MYCPE | Mycoplasma penetrans | 3 | 0.7111 |
Tetracycline repressor protein class D | P0ACT4 | TETR4_ECOLX | Escherichia coli | 2 | 0.7111 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7110 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7110 |
Probable enoyl-CoA hydratase EchA8 | P9WNN9 | ECHA8_MYCTU | Mycobacterium tuberculosis | 3 | 0.7109 |
Probable enoyl-CoA hydratase EchA8 | P9WNN9 | ECHA8_MYCTU | Mycobacterium tuberculosis | 3 | 0.7109 |
Ephrin type-A receptor 2 | P29317 | EPHA2_HUMAN | Homo sapiens | 3 | 0.7106 |
Ephrin type-A receptor 2 | P29317 | EPHA2_HUMAN | Homo sapiens | 3 | 0.7106 |
GTP 3',8-cyclase | P69848 | MOAA_STAA8 | Staphylococcus aureus | 3 | 0.7104 |
GTP 3',8-cyclase | P69848 | MOAA_STAA8 | Staphylococcus aureus | 3 | 0.7104 |
Ribosome-inactivating protein 3 | P25891 | RIP3_MAIZE | Zea mays | 2 | 0.7103 |
Ribosome-inactivating protein 3 | P25891 | RIP3_MAIZE | Zea mays | 2 | 0.7103 |
Genome polyprotein | P12823 | POLG_DEN2P | Dengue virus type 2 | 3 | 0.7099 |
Genome polyprotein | P12823 | POLG_DEN2P | Dengue virus type 2 | 3 | 0.7099 |
Purine nucleoside phosphorylase, putative | A2E7Y6 | A2E7Y6_TRIVA | Trichomonas vaginalis | 2 | 0.7097 |
Thymidine kinase | P0DTH5 | KITH_HHV11 | Human herpesvirus 1 | 2 | 0.7097 |
Thymidine kinase | P0DTH5 | KITH_HHV11 | Human herpesvirus 1 | 2 | 0.7097 |
Purine nucleoside phosphorylase, putative | A2E7Y6 | A2E7Y6_TRIVA | Trichomonas vaginalis | 2 | 0.7097 |
Acidic phospholipase A2 3 | P60045 | PA2A3_NAJSG | Naja sagittifera | 2 | 0.7097 |
Acidic phospholipase A2 3 | P60045 | PA2A3_NAJSG | Naja sagittifera | 2 | 0.7097 |
Adenylate cyclase type 5 | P30803 | ADCY5_CANLF | Canis lupus familiaris | 3 | 0.7091 |
Serine/threonine-protein kinase CtkA | Q9ZKJ5 | CTKA_HELPJ | Helicobacter pylori | 3 | 0.7091 |
Adenylate cyclase type 5 | P30803 | ADCY5_CANLF | Canis lupus familiaris | 3 | 0.7091 |
Serine/threonine-protein kinase CtkA | Q9ZKJ5 | CTKA_HELPJ | Helicobacter pylori | 3 | 0.7091 |
Kynurenine--oxoglutarate transaminase 1 | Q16773 | KAT1_HUMAN | Homo sapiens | 2 | 0.7089 |
Kynurenine--oxoglutarate transaminase 1 | Q16773 | KAT1_HUMAN | Homo sapiens | 2 | 0.7089 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7087 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7087 |
Kinesin-like protein KIF11 | P52732 | KIF11_HUMAN | Homo sapiens | 3 | 0.7087 |
Kinesin-like protein KIF11 | P52732 | KIF11_HUMAN | Homo sapiens | 3 | 0.7087 |
Bifunctional dihydrofolate reductase-thymidylate synthase | A7UD81 | A7UD81_PLAFA | Plasmodium falciparum | 2 | 0.7085 |
Bifunctional dihydrofolate reductase-thymidylate synthase | A7UD81 | A7UD81_PLAFA | Plasmodium falciparum | 2 | 0.7085 |
Purine nucleoside phosphorylase DeoD-type | P0ABP8 | DEOD_ECOLI | Escherichia coli | 3 | 0.7084 |
Purine nucleoside phosphorylase DeoD-type | Q5EEL8 | DEOD_BACCE | Bacillus cereus | 2 | 0.7084 |
Purine nucleoside phosphorylase DeoD-type | P0ABP8 | DEOD_ECOLI | Escherichia coli | 3 | 0.7084 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.7084 |
Fibroblast growth factor receptor 2 | P21802 | FGFR2_HUMAN | Homo sapiens | 3 | 0.7084 |
Purine nucleoside phosphorylase DeoD-type | Q5EEL8 | DEOD_BACCE | Bacillus cereus | 2 | 0.7084 |
RNA 2'-O ribose methyltransferase | Q5SLL8 | Q5SLL8_THET8 | Thermus thermophilus | 3 | 0.7083 |
RNA 2'-O ribose methyltransferase | Q5SLL8 | Q5SLL8_THET8 | Thermus thermophilus | 3 | 0.7083 |
Putative aminoglycoside phosphotransferase | P9WI99 | Y3168_MYCTU | Mycobacterium tuberculosis | 3 | 0.7081 |
Putative aminoglycoside phosphotransferase | P9WI99 | Y3168_MYCTU | Mycobacterium tuberculosis | 3 | 0.7081 |
Disks large homolog 1 | Q12959 | DLG1_HUMAN | Homo sapiens | 3 | 0.7080 |
Disks large homolog 1 | Q12959 | DLG1_HUMAN | Homo sapiens | 3 | 0.7080 |
Beta-1 adrenergic receptor | P07700 | ADRB1_MELGA | Meleagris gallopavo | 2 | 0.7078 |
Beta-1 adrenergic receptor | P07700 | ADRB1_MELGA | Meleagris gallopavo | 2 | 0.7078 |
Sulfotransferase 1A1 | P50225 | ST1A1_HUMAN | Homo sapiens | 2 | 0.7074 |
Sulfotransferase 1A1 | P50225 | ST1A1_HUMAN | Homo sapiens | 2 | 0.7074 |
Cyclin-dependent kinase 2 | P24941 | CDK2_HUMAN | Homo sapiens | 2 | 0.7073 |
Psp operon transcriptional activator | P37344 | PSPF_ECOLI | Escherichia coli | 3 | 0.7073 |
Cyclin-dependent kinase 2 | P24941 | CDK2_HUMAN | Homo sapiens | 2 | 0.7073 |
Psp operon transcriptional activator | P37344 | PSPF_ECOLI | Escherichia coli | 3 | 0.7073 |
Purine nucleoside phosphorylase | P00491 | PNPH_HUMAN | Homo sapiens | 3 | 0.7071 |
Purine nucleoside phosphorylase | P00491 | PNPH_HUMAN | Homo sapiens | 3 | 0.7071 |
Protein mono-ADP-ribosyltransferase PARP3 | Q9Y6F1 | PARP3_HUMAN | Homo sapiens | 4 | 0.7070 |
Protein mono-ADP-ribosyltransferase PARP3 | Q9Y6F1 | PARP3_HUMAN | Homo sapiens | 4 | 0.7070 |
BH2602 protein | Q9K9P3 | Q9K9P3_BACHD | Bacillus halodurans | 2 | 0.7067 |
Carbonic anhydrase 4 | Q64444 | CAH4_MOUSE | Mus musculus | 2 | 0.7067 |
BH2602 protein | Q9K9P3 | Q9K9P3_BACHD | Bacillus halodurans | 2 | 0.7067 |
Carbonic anhydrase 4 | Q64444 | CAH4_MOUSE | Mus musculus | 2 | 0.7067 |
Purine nucleoside phosphorylase DeoD-type | P0ABP9 | DEOD_ECO57 | Escherichia coli O157:H7 | 3 | 0.7065 |
Purine nucleoside phosphorylase DeoD-type | P0ABP9 | DEOD_ECO57 | Escherichia coli O157:H7 | 3 | 0.7065 |
Peripheral plasma membrane protein CASK | O14936 | CSKP_HUMAN | Homo sapiens | 3 | 0.7063 |
Purine nucleoside phosphorylase DeoD-type | P0ABP9 | DEOD_ECO57 | Escherichia coli O157:H7 | 2 | 0.7063 |
Anthranilate phosphoribosyltransferase | P00500 | TRPD_ACIAD | Acinetobacter baylyi | 2 | 0.7063 |
Purine nucleoside phosphorylase DeoD-type | P0ABP9 | DEOD_ECO57 | Escherichia coli O157:H7 | 2 | 0.7063 |
Anthranilate phosphoribosyltransferase | P00500 | TRPD_ACIAD | Acinetobacter baylyi | 2 | 0.7063 |
Peripheral plasma membrane protein CASK | O14936 | CSKP_HUMAN | Homo sapiens | 3 | 0.7063 |
Cyclin-dependent kinase 2 | P24941 | CDK2_HUMAN | Homo sapiens | 2 | 0.7056 |
Cyclin-dependent kinase 2 | P24941 | CDK2_HUMAN | Homo sapiens | 2 | 0.7056 |
Formate--tetrahydrofolate ligase | P21164 | FTHS_MOOTH | Moorella thermoacetica | 2 | 0.7054 |
Formate--tetrahydrofolate ligase | P21164 | FTHS_MOOTH | Moorella thermoacetica | 2 | 0.7054 |
Inosine-5'-monophosphate dehydrogenase | P50097 | IMDH_TRIFO | Tritrichomonas foetus | 2 | 0.7053 |
Inosine-5'-monophosphate dehydrogenase | P50097 | IMDH_TRIFO | Tritrichomonas foetus | 2 | 0.7053 |
Biotin carboxylase | P24182 | ACCC_ECOLI | Escherichia coli | 3 | 0.7051 |
Biotin carboxylase | P24182 | ACCC_ECOLI | Escherichia coli | 3 | 0.7051 |
Arginine kinase | O15992 | KARG_ANTJA | Anthopleura japonica | 2 | 0.7049 |
Arginine kinase | O15992 | KARG_ANTJA | Anthopleura japonica | 2 | 0.7049 |
Carbonic anhydrase 2 | P00918 | CAH2_HUMAN | Homo sapiens | 2 | 0.7048 |
Carbonic anhydrase 2 | P00918 | CAH2_HUMAN | Homo sapiens | 2 | 0.7048 |
SKP1-like protein 1A | Q39255 | SKP1A_ARATH | Arabidopsis thaliana | 2 | 0.7046 |
SKP1-like protein 1A | Q39255 | SKP1A_ARATH | Arabidopsis thaliana | 2 | 0.7046 |
Nitric oxide synthase, inducible | P35228 | NOS2_HUMAN | Homo sapiens | 2 | 0.7042 |
Nitric oxide synthase, inducible | P35228 | NOS2_HUMAN | Homo sapiens | 2 | 0.7042 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 2 | 0.7040 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 2 | 0.7040 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7036 |
Dihydropteroate synthase | Q81VW8 | Q81VW8_BACAN | Bacillus anthracis | 3 | 0.7036 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7036 |
Dihydropteroate synthase | Q81VW8 | Q81VW8_BACAN | Bacillus anthracis | 3 | 0.7036 |
adenine phosphoribosyltransferase | Q967M2 | Q967M2_GIAIN | Giardia intestinalis | 2 | 0.7035 |
APH(2'')-Id | O68183 | O68183_ENTCA | Enterococcus casseliflavus | 3 | 0.7035 |
adenine phosphoribosyltransferase | Q967M2 | Q967M2_GIAIN | Giardia intestinalis | 2 | 0.7035 |
APH(2'')-Id | O68183 | O68183_ENTCA | Enterococcus casseliflavus | 3 | 0.7035 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7033 |
Aurora kinase A | O14965 | AURKA_HUMAN | Homo sapiens | 3 | 0.7033 |
Nicotinamide phosphoribosyltransferase | P43490 | NAMPT_HUMAN | Homo sapiens | 3 | 0.7032 |
Nicotinamide phosphoribosyltransferase | P43490 | NAMPT_HUMAN | Homo sapiens | 3 | 0.7032 |
Activated CDC42 kinase 1 | Q07912 | ACK1_HUMAN | Homo sapiens | 3 | 0.7031 |
Activated CDC42 kinase 1 | Q07912 | ACK1_HUMAN | Homo sapiens | 3 | 0.7031 |
Myosin heavy chain kinase A | P42527 | MHCKA_DICDI | Dictyostelium discoideum | 3 | 0.7031 |
Chitinase A | Q9AMP1 | Q9AMP1_VIBHA | Vibrio harveyi | 2 | 0.7031 |
DNA mismatch repair protein MutS | Q56215 | MUTS_THEAQ | Thermus aquaticus | 2 | 0.7031 |
Pantothenate kinase | P9WPA7 | COAA_MYCTU | Mycobacterium tuberculosis | 2 | 0.7031 |
Fructose-1,6-bisphosphatase 1 | P09467 | F16P1_HUMAN | Homo sapiens | 2 | 0.7031 |
Tryptophan synthase alpha chain | P00929 | TRPA_SALTY | Salmonella typhimurium | 2 | 0.7031 |
Myosin heavy chain kinase A | P42527 | MHCKA_DICDI | Dictyostelium discoideum | 3 | 0.7031 |
Chitinase A | Q9AMP1 | Q9AMP1_VIBHA | Vibrio harveyi | 2 | 0.7031 |
DNA mismatch repair protein MutS | Q56215 | MUTS_THEAQ | Thermus aquaticus | 2 | 0.7031 |
Pantothenate kinase | P9WPA7 | COAA_MYCTU | Mycobacterium tuberculosis | 2 | 0.7031 |
Fructose-1,6-bisphosphatase 1 | P09467 | F16P1_HUMAN | Homo sapiens | 2 | 0.7031 |
Tryptophan synthase alpha chain | P00929 | TRPA_SALTY | Salmonella typhimurium | 2 | 0.7031 |
Heat shock protein HSP 90-alpha | P07900 | HS90A_HUMAN | Homo sapiens | 2 | 0.7028 |
Peroxidase C1A | P00433 | PER1A_ARMRU | Armoracia rusticana | 2 | 0.7028 |
Peroxidase C1A | P00433 | PER1A_ARMRU | Armoracia rusticana | 2 | 0.7028 |
Heat shock protein HSP 90-alpha | P07900 | HS90A_HUMAN | Homo sapiens | 2 | 0.7028 |
4-substituted benzoates-glutamate ligase GH3.12 | Q9LYU4 | GH312_ARATH | Arabidopsis thaliana | 2 | 0.7027 |
Alpha/beta hydrolase fold | A5VAT9 | A5VAT9_SPHWW | Sphingomonas wittichii | 2 | 0.7027 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7027 |
4-substituted benzoates-glutamate ligase GH3.12 | Q9LYU4 | GH312_ARATH | Arabidopsis thaliana | 2 | 0.7027 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7027 |
Alpha/beta hydrolase fold | A5VAT9 | A5VAT9_SPHWW | Sphingomonas wittichii | 2 | 0.7027 |
Glutamate receptor 2 | P19491 | GRIA2_RAT | Rattus norvegicus | 2 | 0.7026 |
Glutamate receptor 2 | P19491 | GRIA2_RAT | Rattus norvegicus | 2 | 0.7026 |
Tyrosine-protein kinase JAK3 | P52333 | JAK3_HUMAN | Homo sapiens | 2 | 0.7022 |
Tyrosine-protein kinase JAK3 | P52333 | JAK3_HUMAN | Homo sapiens | 2 | 0.7022 |
SKP1-like protein 1A | Q39255 | SKP1A_ARATH | Arabidopsis thaliana | 2 | 0.7019 |
Acetolactate synthase, catabolic | P27696 | ILVB_KLEPN | Klebsiella pneumoniae | 2 | 0.7019 |
Acetolactate synthase, catabolic | P27696 | ILVB_KLEPN | Klebsiella pneumoniae | 2 | 0.7019 |
SKP1-like protein 1A | Q39255 | SKP1A_ARATH | Arabidopsis thaliana | 2 | 0.7019 |
Poly(A) polymerase | P29468 | PAP_YEAST | Saccharomyces cerevisiae | 3 | 0.7019 |
Poly(A) polymerase | P29468 | PAP_YEAST | Saccharomyces cerevisiae | 3 | 0.7019 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 2 | 0.7015 |
Streptavidin | P22629 | SAV_STRAV | Streptomyces avidinii | 2 | 0.7015 |
Dihydropteroate synthase | Q81VW8 | Q81VW8_BACAN | Bacillus anthracis | 2 | 0.7014 |
Dihydropteroate synthase | Q81VW8 | Q81VW8_BACAN | Bacillus anthracis | 2 | 0.7014 |
Proline iminopeptidase | O32449 | PIP_SERMA | Serratia marcescens | 2 | 0.7012 |
Proline iminopeptidase | O32449 | PIP_SERMA | Serratia marcescens | 2 | 0.7012 |
Gag-Pol polyprotein | P03369 | POL_HV1A2 | Human immunodeficiency virus type 1 group M subtype B | 2 | 0.7010 |
Gag-Pol polyprotein | P03369 | POL_HV1A2 | Human immunodeficiency virus type 1 group M subtype B | 2 | 0.7010 |
Chaperone protein HtpG | P0A6Z3 | HTPG_ECOLI | Escherichia coli | 2 | 0.7007 |
Avidin | P02701 | AVID_CHICK | Gallus gallus | 2 | 0.7007 |
Chaperone protein HtpG | P0A6Z3 | HTPG_ECOLI | Escherichia coli | 2 | 0.7007 |
Avidin | P02701 | AVID_CHICK | Gallus gallus | 2 | 0.7007 |
Serine/threonine-protein kinase pim-1 | P11309 | PIM1_HUMAN | Homo sapiens | 2 | 0.7006 |
Serine/threonine-protein kinase pim-1 | P11309 | PIM1_HUMAN | Homo sapiens | 2 | 0.7006 |
Alpha/beta hydrolase fold protein | D2J2T6 | D2J2T6_9RHIZ | Ochrobactrum sp. T63 | 2 | 0.7004 |
ActVA 6 protein | Q53908 | Q53908_STRCH | Streptomyces coelicolor | 2 | 0.7004 |
Mitogen-activated protein kinase kinase kinase 21 | Q5TCX8 | M3K21_HUMAN | Homo sapiens | 3 | 0.7004 |
Alpha/beta hydrolase fold protein | D2J2T6 | D2J2T6_9RHIZ | Ochrobactrum sp. T63 | 2 | 0.7004 |
Mitogen-activated protein kinase kinase kinase 21 | Q5TCX8 | M3K21_HUMAN | Homo sapiens | 3 | 0.7004 |
ActVA 6 protein | Q53908 | Q53908_STRCH | Streptomyces coelicolor | 2 | 0.7004 |