Select a section from the left sidebar
Benzyl-1-O-beta-D glucopyranoside
- Family: Plantae - Apiaceae
- Kingdom: Plantae
- Class: Benzenoid
Canonical Smiles | OCC1O[C@H](OCc2ccccc2)[C@@H](C([C@H]1O)O)O |
---|---|
InChI | InChI=1S/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9?,10-,11?,12+,13-/m0/s1 |
InChIKey | GKHCBYYBLTXYEV-TXTTUAKNSA-N |
Formula | C13H18O6 |
HBA | 6 |
HBD | 4 |
MW | 270.28 |
Rotatable Bonds | 4 |
TPSA | 99.38 |
LogP | -1.0 |
Number Rings | 2 |
Number Aromatic Rings | 1 |
Heavy Atom Count | 19 |
Formal Charge | 0 |
Fraction CSP3 | 0.54 |
Exact Mass | 270.11 |
Number of Lipinski Rule Violations | 0 |
# | Species | Family | Kingdom | NCBI Taxonomy ID |
---|---|---|---|---|
1 | Eryngium tricuspidatum | Apiaceae | Plantae | 488472 |
Showing of synonyms
Benzyl-1-O-beta-D glucopyranoside
- Benmerache A, Magid A.A, et al. (2016). Chemical composition, antibacterial, antioxidant and tyrosinase inhibitory activities of glycosides from aerial parts of Eryngium tricuspidatum. Phytochemistry Letters, 2016, 18, 23 - 28. [View]
No compound-protein relationship available.
SMILES: c1ccccc1COC2CCCCO2
Level: 1
Mol. Weight: 270.28 g/mol
SMILES: C1CCOCC1
Level: 0
Mol. Weight: 270.28 g/mol
SMILES: c1ccccc1
Level: 0
Mol. Weight: 270.28 g/mol
Antibacterial
Antioxidant
Absorption
- Caco-2 (logPapp)
- -5.13
- Human Oral Bioavailability 20%
- Bioavailable
- Human Intestinal Absorption
- Absorbed
- Madin-Darby Canine Kidney
- -3.57
- Human Oral Bioavailability 50%
- Non-Bioavailable
- P-Glycoprotein Inhibitor
- Non-Inhibitor
- P-Glycoprotein Substrate
- Non-Substrate
- Skin Permeability
- -2.75
Distribution
- Blood-Brain Barrier (CNS)
- -
- Blood-Brain Barrier
- Penetrable
- Fraction Unbound (Human)
- 0.84
- Plasma Protein Binding
- 51.83
- Steady State Volume of Distribution
- -
Metabolism
- Breast Cancer Resistance Protein
- Non-Inhibitor
- CYP 1A2 Inhibitor
- Non-Inhibitor
- CYP 1A2 Substrate
- Non-Substrate
- CYP 2C19 Inhibitor
- Non-Inhibitor
- CYP 2C19 Substrate
- Non-Substrate
- CYP 2C9 Inhibitor
- Non-Inhibitor
- CYP 2C9 Substrate
- Non-Substrate
- CYP 2D6 Inhibitor
- Non-Inhibitor
- CYP 2D6 Substrate
- Non-Substrate
- CYP 3A4 Inhibitor
- Non-Inhibitor
- CYP 3A4 Substrate
- Non-Substrate
- OATP1B1
- Non-Inhibitor
- OATP1B3
- Non-Inhibitor
Excretion
- Clearance
- 6.38
- Organic Cation Transporter 2
- Non-Inhibitor
- Half-Life of Drug
- -
Toxicity
- AMES Mutagenesis
- Safe
- Avian
- Safe
- Bee
- Toxic
- Bioconcentration Factor
- -0.88
- Biodegradation
- Toxic
- Carcinogenesis
- Safe
- Crustacean
- Safe
- Liver Injury I (DILI)
- Safe
- Eye Corrosion
- Safe
- Eye Irritation
- Safe
- Maximum Tolerated Dose
- 1.56
- Liver Injury II
- Safe
- hERG Blockers
- Safe
- Daphnia Maga
- 4.92
- Micronucleos
- Toxic
- NR-AhR
- Safe
- NR-AR
- Safe
- NR-AR-LBD
- Safe
- NR-Aromatase
- Safe
- NR-ER
- Safe
- NR-ER-LBD
- Safe
- NR-GR
- Safe
- NR-PPAR-gamma
- Safe
- NR-TR
- Safe
- T. Pyriformis
- -1.08
- Rat (Acute)
- 1.84
- Rat (Chronic Oral)
- 3.02
- Fathead Minnow
- 3.36
- Respiratory Disease
- Safe
- Skin Sensitisation
- Toxic
- SR-ARE
- Safe
- SR-ATAD5
- Safe
- SR-HSE
- Safe
- SR-MMP
- Safe
- SR-p53
- Safe
General Properties
- Boiling Point
- 370.64
- Hydration Free Energy
- -19.83
- Log(D) at pH=7.4
- -0.14
- Log(P)
- -0.69
- Log S
- -1.22
- Log(Vapor Pressure)
- -10.05
- Melting Point
- 161.59
- pKa Acid
- 8.55
- pKa Basic
- 2.91
Protein Name | UniProt ID | Entry Name | Species | #Pharmacophore Points | Probability (0.7 ≤ Tversky Score ≤ 1.0) |
---|---|---|---|---|---|
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 4 | 0.9147 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.9091 |
Endothiapepsin | P11838 | CARP_CRYPA | Cryphonectria parasitica | 3 | 0.9048 |
Cathepsin S | P25774 | CATS_HUMAN | Homo sapiens | 3 | 0.8707 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.8682 |
2',3'-cyclic-nucleotide 3'-phosphodiesterase | P16330 | CN37_MOUSE | Mus musculus | 3 | 0.8660 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.8655 |
Methionine aminopeptidase | P0AE18 | MAP1_ECOLI | Escherichia coli | 3 | 0.8586 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.8583 |
Mitogen-activated protein kinase 8 | P45983 | MK08_HUMAN | Homo sapiens | 3 | 0.8561 |
Glucan 1,3-beta-glucosidase | P29717 | EXG1_CANAL | Candida albicans | 3 | 0.8531 |
Methionine aminopeptidase 2 | P9WK19 | MAP12_MYCTU | Mycobacterium tuberculosis | 3 | 0.8520 |
Adenosine 5'-monophosphoramidase HINT1 | P80912 | HINT1_RABIT | Oryctolagus cuniculus | 3 | 0.8493 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.8407 |
Lactoperoxidase | P80025 | PERL_BOVIN | Bos taurus | 3 | 0.8270 |
Protein UshA | P07024 | USHA_ECOLI | Escherichia coli | 3 | 0.8217 |
Thermolysin | P00800 | THER_BACTH | Bacillus thermoproteolyticus | 3 | 0.8197 |
Tetracycline repressor protein class H | P51561 | TETR8_PASMD | Pasteurella multocida | 3 | 0.8166 |
Mitogen-activated protein kinase 8 | P45983 | MK08_HUMAN | Homo sapiens | 3 | 0.8153 |
Prothrombin | P00734 | THRB_HUMAN | Homo sapiens | 3 | 0.8047 |
Xylose isomerase | P24300 | XYLA_STRRU | Streptomyces rubiginosus | 3 | 0.8000 |
Polyribonucleotide nucleotidyltransferase | A7ZS61 | PNP_ECO24 | Escherichia coli O139:H28 | 3 | 0.7919 |
Macrophage metalloelastase | P39900 | MMP12_HUMAN | Homo sapiens | 3 | 0.7918 |
Flavin-dependent monooxygenase | Q93L51 | TETX_BACT4 | Bacteroides thetaiotaomicron | 3 | 0.7911 |
Purine nucleoside phosphorylase DeoD-type | Q5EEL8 | DEOD_BACCE | Bacillus cereus | 3 | 0.7905 |
Adenylate cyclase 2 | A0A2U2H3Y1 | A0A384LKY8_YERPE | Yersinia pestis | 3 | 0.7848 |
Tyrosine-protein kinase JAK2 | O60674 | JAK2_HUMAN | Homo sapiens | 3 | 0.7831 |
Basic phospholipase A2 VRV-PL-VIIIa | P59071 | PA2B8_DABRR | Daboia russelii | 3 | 0.7828 |
Methionine aminopeptidase 1 | P53582 | MAP11_HUMAN | Homo sapiens | 3 | 0.7817 |
Mitogen-activated protein kinase 8 | P45983 | MK08_HUMAN | Homo sapiens | 3 | 0.7729 |
Purine nucleoside phosphorylase DeoD-type | O34925 | DEOD_BACSU | Bacillus subtilis | 3 | 0.7727 |
Raucaffricine-O-beta-D-glucosidase | Q9SPP9 | RG1_RAUSE | Rauvolfia serpentina | 4 | 0.7677 |
Nicotinamide phosphoribosyltransferase | P43490 | NAMPT_HUMAN | Homo sapiens | 3 | 0.7663 |
Endoplasmin | P41148 | ENPL_CANLF | Canis lupus familiaris | 3 | 0.7623 |
Non-receptor tyrosine-protein kinase TYK2 | P29597 | TYK2_HUMAN | Homo sapiens | 3 | 0.7609 |
Tetracycline repressor protein class D | P0ACT4 | TETR4_ECOLX | Escherichia coli | 3 | 0.7534 |
Non-receptor tyrosine-protein kinase TYK2 | P29597 | TYK2_HUMAN | Homo sapiens | 3 | 0.7517 |
Chloramphenicol 3-O phosphotransferase | Q56148 | CPT_STRVP | Streptomyces venezuelae | 3 | 0.7489 |
Endoplasmin | P41148 | ENPL_CANLF | Canis lupus familiaris | 3 | 0.7460 |
NAD(P) transhydrogenase subunit alpha part 1 | Q2RSB2 | PNTAA_RHORT | Rhodospirillum rubrum | 3 | 0.7448 |
7-methylguanosine phosphate-specific 5'-nucleotidase | Q9W197 | 5NT3B_DROME | Drosophila melanogaster | 3 | 0.7386 |
NADPH-dependent oxidoreductase 2-alkenal reductase | Q39172 | AER_ARATH | Arabidopsis thaliana | 2 | 0.7369 |
Endoplasmin | P41148 | ENPL_CANLF | Canis lupus familiaris | 3 | 0.7347 |
Cytosol aminopeptidase | O86436 | AMPA_PSEPU | Pseudomonas putida | 3 | 0.7341 |
Pantothenate kinase | P9WPA7 | COAA_MYCTU | Mycobacterium tuberculosis | 3 | 0.7337 |
Non-receptor tyrosine-protein kinase TYK2 | P29597 | TYK2_HUMAN | Homo sapiens | 3 | 0.7322 |
Purine nucleoside phosphorylase DeoD-type | P0ABP9 | DEOD_ECO57 | Escherichia coli O157:H7 | 3 | 0.7321 |
Adenosine 5'-monophosphoramidase HINT1 | P80912 | HINT1_RABIT | Oryctolagus cuniculus | 3 | 0.7298 |
Pentaerythritol tetranitrate reductase | P71278 | P71278_ENTCL | Enterobacter cloacae | 2 | 0.7253 |
Beta-glucosidase 1A | Q25BW5 | BGL1A_PHACH | Phanerodontia chrysosporium | 3 | 0.7253 |
Pantothenate kinase | P9WPA7 | COAA_MYCTU | Mycobacterium tuberculosis | 3 | 0.7233 |
Flavoredoxin | Q72HI0 | Q72HI0_THET2 | Thermus thermophilus | 2 | 0.7216 |
Mycocyclosin synthase | P9WPP7 | CP121_MYCTU | Mycobacterium tuberculosis | 2 | 0.7193 |
Ribonucleoside-diphosphate reductase large chain 1 | P21524 | RIR1_YEAST | Saccharomyces cerevisiae | 3 | 0.7184 |
Coagulation factor X | P00742 | FA10_HUMAN | Homo sapiens | 2 | 0.7163 |
Protein claret segregational | P20480 | NCD_DROME | Drosophila melanogaster | 2 | 0.7147 |
Carbonic anhydrase 1 | P00915 | CAH1_HUMAN | Homo sapiens | 2 | 0.7143 |
Leucine--tRNA ligase | P07813 | SYL_ECOLI | Escherichia coli | 3 | 0.7128 |
Alpha-aminoadipic semialdehyde dehydrogenase | P49419 | AL7A1_HUMAN | Homo sapiens | 3 | 0.7113 |
Reaction center protein L chain | P0C0Y7 | RCEH_RHOSH | Rhodobacter sphaeroides | 3 | 0.7111 |
Lethal factor | P15917 | LEF_BACAN | Bacillus anthracis | 3 | 0.7110 |
Mitogen-activated protein kinase 1 | P28482 | MK01_HUMAN | Homo sapiens | 2 | 0.7092 |
D-aminoacyl-tRNA deacylase | Q8IIS0 | DTD_PLAF7 | Plasmodium falciparum | 2 | 0.7081 |
Glycogen synthase kinase-3 beta | P49841 | GSK3B_HUMAN | Homo sapiens | 3 | 0.7079 |
Methionine aminopeptidase 2 | P9WK19 | MAP12_MYCTU | Mycobacterium tuberculosis | 3 | 0.7077 |
Carbonic anhydrase 4 | Q64444 | CAH4_MOUSE | Mus musculus | 2 | 0.7072 |
Nitric oxide synthase, inducible | P29477 | NOS2_MOUSE | Mus musculus | 2 | 0.7064 |
Beta-glucosidase | Q8T0W7 | Q8T0W7_9NEOP | Neotermes koshunensis | 3 | 0.7062 |
Putative b-glycan phosphorylase | Q21MB1 | Q21MB1_SACD2 | Saccharophagus degradans | 4 | 0.7058 |
Purine nucleoside phosphorylase DeoD-type | Q5EEL8 | DEOD_BACCE | Bacillus cereus | 3 | 0.7048 |
5-methylthioadenosine/S-adenosylhomocysteine deaminase | Q7NZ90 | Q7NZ90_CHRVO | Chromobacterium violaceum | 3 | 0.7042 |
Ribosome-inactivating protein alpha-trichosanthin | P09989 | RIPT_TRIKI | Trichosanthes kirilowii | 3 | 0.7036 |
Glutathione S-transferase A1 | P08263 | GSTA1_HUMAN | Homo sapiens | 3 | 0.7030 |
Gag-Pol polyprotein | P0C6F2 | POL_HV1LW | Human immunodeficiency virus type 1 group M subtype B | 3 | 0.7027 |
Matrix metalloproteinase-20 | O60882 | MMP20_HUMAN | Homo sapiens | 2 | 0.7026 |
Penicillin V acylase | P12256 | PAC_LYSSH | Lysinibacillus sphaericus | 3 | 0.7020 |
2-phospho-L-lactate transferase | Q8PVT6 | COFD_METMA | Methanosarcina mazei | 2 | 0.7017 |
Acidic phospholipase A2 3 | P60045 | PA2A3_NAJSG | Naja sagittifera | 2 | 0.7009 |